C12H16N2O — CID 66882723
1,2,3,4,4a,5,6,9-octahydropyrido[2,1-f][1,6]naphthyridin-8-one (PubChem CID 66882723) has the molecular formula C12H16N2O and a molecular weight of 204.27 g/mol. Its IUPAC name is 1,2,3,4,4a,5,6,9-octahydropyrido[2,1-f][1,6]naphthyridin-8-one.
| Compound Name | 1,2,3,4,4a,5,6,9-octahydropyrido[2,1-f][1,6]naphthyridin-8-one |
|---|---|
| PubChem CID | 66882723 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | 1,2,3,4,4a,5,6,9-octahydropyrido[2,1-f][1,6]naphthyridin-8-one |
| SMILES | O=C1CC=CC2=C3CCCNC3CCN12 |
| InChI | InChI=1S/C12H16N2O/c15-12-5-1-4-11-9-3-2-7-13-10(9)6-8-14(11)12/h1,4,10,13H,2-3,5-8H2 |
| InChIKey | XEUOPYJHGCJEDQ-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |