About [6-(4-fluorophenyl)-3-methylimidazo[2,1-b][1,3]thiazol-2-yl] N-tert-butylcarbamate
[6-(4-fluorophenyl)-3-methylimidazo[2,1-b][1,3]thiazol-2-yl] N-tert-butylcarbamate (PubChem CID 66882977) has the molecular formula C17H18FN3O2S
and a molecular weight of 347.42 g/mol. Its IUPAC name is [6-(4-fluorophenyl)-3-methylimidazo[2,1-b][1,3]thiazol-2-yl] N-tert-butylcarbamate.
Molecular Properties
| Compound Name | [6-(4-fluorophenyl)-3-methylimidazo[2,1-b][1,3]thiazol-2-yl] N-tert-butylcarbamate |
| PubChem CID | 66882977 |
| Molecular Formula | C17H18FN3O2S |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | [6-(4-fluorophenyl)-3-methylimidazo[2,1-b][1,3]thiazol-2-yl] N-tert-butylcarbamate |
| SMILES | Cc1c(OC(=O)NC(C)(C)C)sc2nc(-c3ccc(F)cc3)cn12 |
| InChI | InChI=1S/C17H18FN3O2S/c1-10-14(23-16(22)20-17(2,3)4)24-15-19-13(9-21(10)15)11-5-7-12(18)8-6-11/h5-9H,1-4H3,(H,20,22) |
| InChIKey | NCKLZDAGPDWJCN-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [6-(4-fluorophenyl)-3-methylimidazo[2,1-b][1,3]thiazol-2-yl] N-tert-butylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-(4-fluorophenyl)-3-methylimidazo[2,1-b][1,3]thiazol-2-yl] N-tert-butylcarbamate?
The IUPAC name of [6-(4-fluorophenyl)-3-methylimidazo[2,1-b][1,3]thiazol-2-yl] N-tert-butylcarbamate (CID 66882977) is [6-(4-fluorophenyl)-3-methylimidazo[2,1-b][1,3]thiazol-2-yl] N-tert-butylcarbamate.
What is the SMILES notation for [6-(4-fluorophenyl)-3-methylimidazo[2,1-b][1,3]thiazol-2-yl] N-tert-butylcarbamate?
The canonical SMILES for [6-(4-fluorophenyl)-3-methylimidazo[2,1-b][1,3]thiazol-2-yl] N-tert-butylcarbamate is Cc1c(OC(=O)NC(C)(C)C)sc2nc(-c3ccc(F)cc3)cn12.
What is the InChIKey of [6-(4-fluorophenyl)-3-methylimidazo[2,1-b][1,3]thiazol-2-yl] N-tert-butylcarbamate?
The InChIKey is NCKLZDAGPDWJCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18FN3O2S/c1-10-14(23-16(22)20-17(2,3)4)24-15-19-13(9-21(10)15)11-5-7-12(18)8-6-11/h5-9H,1-4H3,(H,20,22).
What are the key properties of [6-(4-fluorophenyl)-3-methylimidazo[2,1-b][1,3]thiazol-2-yl] N-tert-butylcarbamate?
[6-(4-fluorophenyl)-3-methylimidazo[2,1-b][1,3]thiazol-2-yl] N-tert-butylcarbamate has a molecular weight of 347.42 g/mol, XLogP of 4.40, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [6-(4-fluorophenyl)-3-methylimidazo[2,1-b][1,3]thiazol-2-yl] N-tert-butylcarbamate is sourced from PubChem (CID 66882977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).