C17H35FO5Si2 — CID 66883009
(3R,4R,5S)-4,6-bis[[tert-butyl(dimethyl)silyl]oxy]-3-fluoro-5-hydroxyoxan-2-one (PubChem CID 66883009) has the molecular formula C17H35FO5Si2 and a molecular weight of 394.63 g/mol. Its IUPAC name is (3R,4R,5S)-4,6-bis[[tert-butyl(dimethyl)silyl]oxy]-3-fluoro-5-hydroxyoxan-2-one.
| Compound Name | (3R,4R,5S)-4,6-bis[[tert-butyl(dimethyl)silyl]oxy]-3-fluoro-5-hydroxyoxan-2-one |
|---|---|
| PubChem CID | 66883009 |
| Molecular Formula | C17H35FO5Si2 |
| Molecular Weight | 394.63 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | (3R,4R,5S)-4,6-bis[[tert-butyl(dimethyl)silyl]oxy]-3-fluoro-5-hydroxyoxan-2-one |
| SMILES | CC(C)(C)[Si](C)(C)OC1OC(=O)[C@H](F)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O |
| InChI | InChI=1S/C17H35FO5Si2/c1-16(2,3)24(7,8)22-13-11(18)14(20)21-15(12(13)19)23-25(9,10)17(4,5)6/h11-13,15,19H,1-10H3/t11-,12+,13+,15?/m1/s1 |
| InChIKey | ZRFUUYKVBCIHGA-MHDSIBQVSA-N |
| XLogP | 3.98 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.63 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|