C23H47FO5Si2 — CID 66883077
(3R,4R,5S)-3-fluoro-5-hydroxy-4,6-bis[tri(propan-2-yl)silyloxy]oxan-2-one (PubChem CID 66883077) has the molecular formula C23H47FO5Si2 and a molecular weight of 478.79 g/mol. Its IUPAC name is (3R,4R,5S)-3-fluoro-5-hydroxy-4,6-bis[tri(propan-2-yl)silyloxy]oxan-2-one.
| Compound Name | (3R,4R,5S)-3-fluoro-5-hydroxy-4,6-bis[tri(propan-2-yl)silyloxy]oxan-2-one |
|---|---|
| PubChem CID | 66883077 |
| Molecular Formula | C23H47FO5Si2 |
| Molecular Weight | 478.79 g/mol |
| Exact Mass | 478.29 |
| IUPAC Name | (3R,4R,5S)-3-fluoro-5-hydroxy-4,6-bis[tri(propan-2-yl)silyloxy]oxan-2-one |
| SMILES | CC(C)[Si](OC1OC(=O)[C@H](F)[C@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@@H]1O)(C(C)C)C(C)C |
| InChI | InChI=1S/C23H47FO5Si2/c1-13(2)30(14(3)4,15(5)6)28-21-19(24)22(26)27-23(20(21)25)29-31(16(7)8,17(9)10)18(11)12/h13-21,23,25H,1-12H3/t19-,20+,21+,23?/m1/s1 |
| InChIKey | VYTWDIXDVUHNBS-NSRDPVEOSA-N |
| XLogP | 6.32 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.79 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|