C20H18N2O3S — CID 66883453
3-(benzenesulfonyl)-2-phenyl-5,6,7,8-tetrahydroquinazolin-4-one (PubChem CID 66883453) has the molecular formula C20H18N2O3S and a molecular weight of 366.44 g/mol. Its IUPAC name is 3-(benzenesulfonyl)-2-phenyl-5,6,7,8-tetrahydroquinazolin-4-one.
| Compound Name | 3-(benzenesulfonyl)-2-phenyl-5,6,7,8-tetrahydroquinazolin-4-one |
|---|---|
| PubChem CID | 66883453 |
| Molecular Formula | C20H18N2O3S |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | 3-(benzenesulfonyl)-2-phenyl-5,6,7,8-tetrahydroquinazolin-4-one |
| SMILES | O=c1c2c(nc(-c3ccccc3)n1S(=O)(=O)c1ccccc1)CCCC2 |
| InChI | InChI=1S/C20H18N2O3S/c23-20-17-13-7-8-14-18(17)21-19(15-9-3-1-4-10-15)22(20)26(24,25)16-11-5-2-6-12-16/h1-6,9-12H,7-8,13-14H2 |
| InChIKey | WWFUAMQUGHHFJB-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 69.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |