About methyl 4-bis(2,4,6-trimethylbenzoyl)phosphoryl-3-oxobutanoate
methyl 4-bis(2,4,6-trimethylbenzoyl)phosphoryl-3-oxobutanoate (PubChem CID 66883972) has the molecular formula C25H29O6P
and a molecular weight of 456.48 g/mol. Its IUPAC name is methyl 4-bis(2,4,6-trimethylbenzoyl)phosphoryl-3-oxobutanoate.
Molecular Properties
| Compound Name | methyl 4-bis(2,4,6-trimethylbenzoyl)phosphoryl-3-oxobutanoate |
| PubChem CID | 66883972 |
| Molecular Formula | C25H29O6P |
| Molecular Weight | 456.48 g/mol |
| Exact Mass | 456.17 |
| IUPAC Name | methyl 4-bis(2,4,6-trimethylbenzoyl)phosphoryl-3-oxobutanoate |
| SMILES | COC(=O)CC(=O)CP(=O)(C(=O)c1c(C)cc(C)cc1C)C(=O)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C25H29O6P/c1-14-8-16(3)22(17(4)9-14)24(28)32(30,13-20(26)12-21(27)31-7)25(29)23-18(5)10-15(2)11-19(23)6/h8-11H,12-13H2,1-7H3 |
| InChIKey | JBFFUBHWNVHDFT-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 94.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 456.48 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-bis(2,4,6-trimethylbenzoyl)phosphoryl-3-oxobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-bis(2,4,6-trimethylbenzoyl)phosphoryl-3-oxobutanoate?
The IUPAC name of methyl 4-bis(2,4,6-trimethylbenzoyl)phosphoryl-3-oxobutanoate (CID 66883972) is methyl 4-bis(2,4,6-trimethylbenzoyl)phosphoryl-3-oxobutanoate.
What is the SMILES notation for methyl 4-bis(2,4,6-trimethylbenzoyl)phosphoryl-3-oxobutanoate?
The canonical SMILES for methyl 4-bis(2,4,6-trimethylbenzoyl)phosphoryl-3-oxobutanoate is COC(=O)CC(=O)CP(=O)(C(=O)c1c(C)cc(C)cc1C)C(=O)c1c(C)cc(C)cc1C.
What is the InChIKey of methyl 4-bis(2,4,6-trimethylbenzoyl)phosphoryl-3-oxobutanoate?
The InChIKey is JBFFUBHWNVHDFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H29O6P/c1-14-8-16(3)22(17(4)9-14)24(28)32(30,13-20(26)12-21(27)31-7)25(29)23-18(5)10-15(2)11-19(23)6/h8-11H,12-13H2,1-7H3.
What are the key properties of methyl 4-bis(2,4,6-trimethylbenzoyl)phosphoryl-3-oxobutanoate?
methyl 4-bis(2,4,6-trimethylbenzoyl)phosphoryl-3-oxobutanoate has a molecular weight of 456.48 g/mol, XLogP of 5.01, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-bis(2,4,6-trimethylbenzoyl)phosphoryl-3-oxobutanoate is sourced from PubChem (CID 66883972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).