C5H6F2O4 — CID 66884134
(4R,5R)-3,3-difluoro-4,5-dihydroxyoxan-2-one (PubChem CID 66884134) has the molecular formula C5H6F2O4 and a molecular weight of 168.09 g/mol. Its IUPAC name is (4R,5R)-3,3-difluoro-4,5-dihydroxyoxan-2-one.
| Compound Name | (4R,5R)-3,3-difluoro-4,5-dihydroxyoxan-2-one |
|---|---|
| PubChem CID | 66884134 |
| Molecular Formula | C5H6F2O4 |
| Molecular Weight | 168.09 g/mol |
| Exact Mass | 168.02 |
| IUPAC Name | (4R,5R)-3,3-difluoro-4,5-dihydroxyoxan-2-one |
| SMILES | O=C1OC[C@@H](O)[C@@H](O)C1(F)F |
| InChI | InChI=1S/C5H6F2O4/c6-5(7)3(9)2(8)1-11-4(5)10/h2-3,8-9H,1H2/t2-,3-/m1/s1 |
| InChIKey | GTNQDPPKSOCDOG-PWNYCUMCSA-N |
| XLogP | -1.10 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.09 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |