C24H26Cl3NO6 — CID 66884295
[(2S,3R,4R,5S,6S)-6-methyl-4,5-bis(phenylmethoxy)-2-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl] acetate (PubChem CID 66884295) has the molecular formula C24H26Cl3NO6 and a molecular weight of 530.83 g/mol. Its IUPAC name is [(2S,3R,4R,5S,6S)-6-methyl-4,5-bis(phenylmethoxy)-2-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl] acetate.
| Compound Name | [(2S,3R,4R,5S,6S)-6-methyl-4,5-bis(phenylmethoxy)-2-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl] acetate |
|---|---|
| PubChem CID | 66884295 |
| Molecular Formula | C24H26Cl3NO6 |
| Molecular Weight | 530.83 g/mol |
| Exact Mass | 529.08 |
| IUPAC Name | [(2S,3R,4R,5S,6S)-6-methyl-4,5-bis(phenylmethoxy)-2-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl] acetate |
| SMILES | [H]/N=C(/O[C@@H]1O[C@@H](C)[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@H]1OC(C)=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C24H26Cl3NO6/c1-15-19(30-13-17-9-5-3-6-10-17)20(31-14-18-11-7-4-8-12-18)21(33-16(2)29)22(32-15)34-23(28)24(25,26)27/h3-12,15,19-22,28H,13-14H2,1-2H3/b28-23+/t15-,19-,20+,21+,22-/m0/s1 |
| InChIKey | MCIRLVLTRDSWTC-CUZSIOQWSA-N |
| XLogP | 5.20 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.83 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|