About ethyl 4-bis(2,4,6-trimethylbenzoyl)phosphoryl-3-oxobutanoate
ethyl 4-bis(2,4,6-trimethylbenzoyl)phosphoryl-3-oxobutanoate (PubChem CID 66884379) has the molecular formula C26H31O6P
and a molecular weight of 470.50 g/mol. Its IUPAC name is ethyl 4-bis(2,4,6-trimethylbenzoyl)phosphoryl-3-oxobutanoate.
Molecular Properties
| Compound Name | ethyl 4-bis(2,4,6-trimethylbenzoyl)phosphoryl-3-oxobutanoate |
| PubChem CID | 66884379 |
| Molecular Formula | C26H31O6P |
| Molecular Weight | 470.50 g/mol |
| Exact Mass | 470.19 |
| IUPAC Name | ethyl 4-bis(2,4,6-trimethylbenzoyl)phosphoryl-3-oxobutanoate |
| SMILES | CCOC(=O)CC(=O)CP(=O)(C(=O)c1c(C)cc(C)cc1C)C(=O)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C26H31O6P/c1-8-32-22(28)13-21(27)14-33(31,25(29)23-17(4)9-15(2)10-18(23)5)26(30)24-19(6)11-16(3)12-20(24)7/h9-12H,8,13-14H2,1-7H3 |
| InChIKey | XFTMXMPPKYUMFT-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 94.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 470.50 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze ethyl 4-bis(2,4,6-trimethylbenzoyl)phosphoryl-3-oxobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-bis(2,4,6-trimethylbenzoyl)phosphoryl-3-oxobutanoate?
The IUPAC name of ethyl 4-bis(2,4,6-trimethylbenzoyl)phosphoryl-3-oxobutanoate (CID 66884379) is ethyl 4-bis(2,4,6-trimethylbenzoyl)phosphoryl-3-oxobutanoate.
What is the SMILES notation for ethyl 4-bis(2,4,6-trimethylbenzoyl)phosphoryl-3-oxobutanoate?
The canonical SMILES for ethyl 4-bis(2,4,6-trimethylbenzoyl)phosphoryl-3-oxobutanoate is CCOC(=O)CC(=O)CP(=O)(C(=O)c1c(C)cc(C)cc1C)C(=O)c1c(C)cc(C)cc1C.
What is the InChIKey of ethyl 4-bis(2,4,6-trimethylbenzoyl)phosphoryl-3-oxobutanoate?
The InChIKey is XFTMXMPPKYUMFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H31O6P/c1-8-32-22(28)13-21(27)14-33(31,25(29)23-17(4)9-15(2)10-18(23)5)26(30)24-19(6)11-16(3)12-20(24)7/h9-12H,8,13-14H2,1-7H3.
What are the key properties of ethyl 4-bis(2,4,6-trimethylbenzoyl)phosphoryl-3-oxobutanoate?
ethyl 4-bis(2,4,6-trimethylbenzoyl)phosphoryl-3-oxobutanoate has a molecular weight of 470.50 g/mol, XLogP of 5.40, 9 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-bis(2,4,6-trimethylbenzoyl)phosphoryl-3-oxobutanoate is sourced from PubChem (CID 66884379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).