About 3-methyl-9H-thioxanthene 10-oxide
3-methyl-9H-thioxanthene 10-oxide (PubChem CID 66885365) has the molecular formula C14H12OS
and a molecular weight of 228.32 g/mol. Its IUPAC name is 3-methyl-9H-thioxanthene 10-oxide.
Molecular Properties
| Compound Name | 3-methyl-9H-thioxanthene 10-oxide |
| PubChem CID | 66885365 |
| Molecular Formula | C14H12OS |
| Molecular Weight | 228.32 g/mol |
| Exact Mass | 228.06 |
| IUPAC Name | 3-methyl-9H-thioxanthene 10-oxide |
| SMILES | Cc1ccc2c(c1)S(=O)c1ccccc1C2 |
| InChI | InChI=1S/C14H12OS/c1-10-6-7-12-9-11-4-2-3-5-13(11)16(15)14(12)8-10/h2-8H,9H2,1H3 |
| InChIKey | NCFHKKXEROOEHN-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.32 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-methyl-9H-thioxanthene 10-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-9H-thioxanthene 10-oxide?
The IUPAC name of 3-methyl-9H-thioxanthene 10-oxide (CID 66885365) is 3-methyl-9H-thioxanthene 10-oxide.
What is the SMILES notation for 3-methyl-9H-thioxanthene 10-oxide?
The canonical SMILES for 3-methyl-9H-thioxanthene 10-oxide is Cc1ccc2c(c1)S(=O)c1ccccc1C2.
What is the InChIKey of 3-methyl-9H-thioxanthene 10-oxide?
The InChIKey is NCFHKKXEROOEHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12OS/c1-10-6-7-12-9-11-4-2-3-5-13(11)16(15)14(12)8-10/h2-8H,9H2,1H3.
What are the key properties of 3-methyl-9H-thioxanthene 10-oxide?
3-methyl-9H-thioxanthene 10-oxide has a molecular weight of 228.32 g/mol, XLogP of 3.07, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-9H-thioxanthene 10-oxide is sourced from PubChem (CID 66885365), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).