About 3-[4-(3,5-dichlorophenyl)-2-methylisoquinolin-2-ium-7-yl]oxypropan-1-ol
3-[4-(3,5-dichlorophenyl)-2-methylisoquinolin-2-ium-7-yl]oxypropan-1-ol (PubChem CID 66885369) has the molecular formula C19H18Cl2NO2+
and a molecular weight of 363.26 g/mol. Its IUPAC name is 3-[4-(3,5-dichlorophenyl)-2-methylisoquinolin-2-ium-7-yl]oxypropan-1-ol.
Molecular Properties
| Compound Name | 3-[4-(3,5-dichlorophenyl)-2-methylisoquinolin-2-ium-7-yl]oxypropan-1-ol |
| PubChem CID | 66885369 |
| Molecular Formula | C19H18Cl2NO2+ |
| Molecular Weight | 363.26 g/mol |
| Exact Mass | 362.07 |
| IUPAC Name | 3-[4-(3,5-dichlorophenyl)-2-methylisoquinolin-2-ium-7-yl]oxypropan-1-ol |
| SMILES | C[n+]1cc(-c2cc(Cl)cc(Cl)c2)c2ccc(OCCCO)cc2c1 |
| InChI | InChI=1S/C19H18Cl2NO2/c1-22-11-14-9-17(24-6-2-5-23)3-4-18(14)19(12-22)13-7-15(20)10-16(21)8-13/h3-4,7-12,23H,2,5-6H2,1H3/q+1 |
| InChIKey | IQSXIKPQFHTFIP-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 33.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.26 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 3-[4-(3,5-dichlorophenyl)-2-methylisoquinolin-2-ium-7-yl]oxypropan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-(3,5-dichlorophenyl)-2-methylisoquinolin-2-ium-7-yl]oxypropan-1-ol?
The IUPAC name of 3-[4-(3,5-dichlorophenyl)-2-methylisoquinolin-2-ium-7-yl]oxypropan-1-ol (CID 66885369) is 3-[4-(3,5-dichlorophenyl)-2-methylisoquinolin-2-ium-7-yl]oxypropan-1-ol.
What is the SMILES notation for 3-[4-(3,5-dichlorophenyl)-2-methylisoquinolin-2-ium-7-yl]oxypropan-1-ol?
The canonical SMILES for 3-[4-(3,5-dichlorophenyl)-2-methylisoquinolin-2-ium-7-yl]oxypropan-1-ol is C[n+]1cc(-c2cc(Cl)cc(Cl)c2)c2ccc(OCCCO)cc2c1.
What is the InChIKey of 3-[4-(3,5-dichlorophenyl)-2-methylisoquinolin-2-ium-7-yl]oxypropan-1-ol?
The InChIKey is IQSXIKPQFHTFIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18Cl2NO2/c1-22-11-14-9-17(24-6-2-5-23)3-4-18(14)19(12-22)13-7-15(20)10-16(21)8-13/h3-4,7-12,23H,2,5-6H2,1H3/q+1.
What are the key properties of 3-[4-(3,5-dichlorophenyl)-2-methylisoquinolin-2-ium-7-yl]oxypropan-1-ol?
3-[4-(3,5-dichlorophenyl)-2-methylisoquinolin-2-ium-7-yl]oxypropan-1-ol has a molecular weight of 363.26 g/mol, XLogP of 4.40, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(3,5-dichlorophenyl)-2-methylisoquinolin-2-ium-7-yl]oxypropan-1-ol is sourced from PubChem (CID 66885369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).