C11H25BClNO2 — CID 66886220
3-methyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butan-1-amine;hydrochloride (PubChem CID 66886220) has the molecular formula C11H25BClNO2 and a molecular weight of 249.59 g/mol. Its IUPAC name is 3-methyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butan-1-amine;hydrochloride.
| Compound Name | 3-methyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 66886220 |
| Molecular Formula | C11H25BClNO2 |
| Molecular Weight | 249.59 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | 3-methyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butan-1-amine;hydrochloride |
| SMILES | CC(C)CC(N)B1OC(C)(C)C(C)(C)O1.Cl |
| InChI | InChI=1S/C11H24BNO2.ClH/c1-8(2)7-9(13)12-14-10(3,4)11(5,6)15-12;/h8-9H,7,13H2,1-6H3;1H |
| InChIKey | ADICRSVFBDCOLO-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.59 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|