2-oxo-1,5,7,8-tetrahydro-1,6-naphthyridine-6-carboxylic acid

C9H10N2O3 — CID 66886375

IUPAC2-oxo-1,5,7,8-tetrahydro-1,6-naphthyridine-6-carboxylic acid
SMILESO=C(O)N1CCc2[nH]c(=O)ccc2C1
InChIInChI=1S/C9H10N2O3/c12-8-2-1-6-5-11(9(13)14)4-3-7(6)10-8/h1-2H,3-5H2,(H,10,12)(H,13,14)
InChIKeyRVYFQNMZOAEOCQ-UHFFFAOYSA-N
MW194.19 g/mol
LogP0.41
Rot. Bonds

About 2-oxo-1,5,7,8-tetrahydro-1,6-naphthyridine-6-carboxylic acid

2-oxo-1,5,7,8-tetrahydro-1,6-naphthyridine-6-carboxylic acid (PubChem CID 66886375) has the molecular formula C9H10N2O3 and a molecular weight of 194.19 g/mol. Its IUPAC name is 2-oxo-1,5,7,8-tetrahydro-1,6-naphthyridine-6-carboxylic acid.

Molecular Properties

Compound Name2-oxo-1,5,7,8-tetrahydro-1,6-naphthyridine-6-carboxylic acid
PubChem CID66886375
Molecular FormulaC9H10N2O3
Molecular Weight194.19 g/mol
Exact Mass194.07
IUPAC Name2-oxo-1,5,7,8-tetrahydro-1,6-naphthyridine-6-carboxylic acid
SMILESO=C(O)N1CCc2[nH]c(=O)ccc2C1
InChIInChI=1S/C9H10N2O3/c12-8-2-1-6-5-11(9(13)14)4-3-7(6)10-8/h1-2H,3-5H2,(H,10,12)(H,13,14)
InChIKeyRVYFQNMZOAEOCQ-UHFFFAOYSA-N
XLogP0.41
TPSA73.40 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500194.19
LogP ≤ 50.41
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-oxo-1,5,7,8-tetrahydro-1,6-naphthyridine-6-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-oxo-1,5,7,8-tetrahydro-1,6-naphthyridine-6-carboxylic acid?
The IUPAC name of 2-oxo-1,5,7,8-tetrahydro-1,6-naphthyridine-6-carboxylic acid (CID 66886375) is 2-oxo-1,5,7,8-tetrahydro-1,6-naphthyridine-6-carboxylic acid.
What is the SMILES notation for 2-oxo-1,5,7,8-tetrahydro-1,6-naphthyridine-6-carboxylic acid?
The canonical SMILES for 2-oxo-1,5,7,8-tetrahydro-1,6-naphthyridine-6-carboxylic acid is O=C(O)N1CCc2[nH]c(=O)ccc2C1.
What is the InChIKey of 2-oxo-1,5,7,8-tetrahydro-1,6-naphthyridine-6-carboxylic acid?
The InChIKey is RVYFQNMZOAEOCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2O3/c12-8-2-1-6-5-11(9(13)14)4-3-7(6)10-8/h1-2H,3-5H2,(H,10,12)(H,13,14).
What are the key properties of 2-oxo-1,5,7,8-tetrahydro-1,6-naphthyridine-6-carboxylic acid?
2-oxo-1,5,7,8-tetrahydro-1,6-naphthyridine-6-carboxylic acid has a molecular weight of 194.19 g/mol, XLogP of 0.41, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxo-1,5,7,8-tetrahydro-1,6-naphthyridine-6-carboxylic acid is sourced from PubChem (CID 66886375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).