About 2-(bromomethyl)-7-methylsulfonyl-4H-1,3-benzodioxine
2-(bromomethyl)-7-methylsulfonyl-4H-1,3-benzodioxine (PubChem CID 66886440) has the molecular formula C10H11BrO4S
and a molecular weight of 307.17 g/mol. Its IUPAC name is 2-(bromomethyl)-7-methylsulfonyl-4H-1,3-benzodioxine.
Molecular Properties
| Compound Name | 2-(bromomethyl)-7-methylsulfonyl-4H-1,3-benzodioxine |
| PubChem CID | 66886440 |
| Molecular Formula | C10H11BrO4S |
| Molecular Weight | 307.17 g/mol |
| Exact Mass | 305.96 |
| IUPAC Name | 2-(bromomethyl)-7-methylsulfonyl-4H-1,3-benzodioxine |
| SMILES | CS(=O)(=O)c1ccc2c(c1)OC(CBr)OC2 |
| InChI | InChI=1S/C10H11BrO4S/c1-16(12,13)8-3-2-7-6-14-10(5-11)15-9(7)4-8/h2-4,10H,5-6H2,1H3 |
| InChIKey | FDXHOZFNODPOQA-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.17 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-(bromomethyl)-7-methylsulfonyl-4H-1,3-benzodioxine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(bromomethyl)-7-methylsulfonyl-4H-1,3-benzodioxine?
The IUPAC name of 2-(bromomethyl)-7-methylsulfonyl-4H-1,3-benzodioxine (CID 66886440) is 2-(bromomethyl)-7-methylsulfonyl-4H-1,3-benzodioxine.
What is the SMILES notation for 2-(bromomethyl)-7-methylsulfonyl-4H-1,3-benzodioxine?
The canonical SMILES for 2-(bromomethyl)-7-methylsulfonyl-4H-1,3-benzodioxine is CS(=O)(=O)c1ccc2c(c1)OC(CBr)OC2.
What is the InChIKey of 2-(bromomethyl)-7-methylsulfonyl-4H-1,3-benzodioxine?
The InChIKey is FDXHOZFNODPOQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11BrO4S/c1-16(12,13)8-3-2-7-6-14-10(5-11)15-9(7)4-8/h2-4,10H,5-6H2,1H3.
What are the key properties of 2-(bromomethyl)-7-methylsulfonyl-4H-1,3-benzodioxine?
2-(bromomethyl)-7-methylsulfonyl-4H-1,3-benzodioxine has a molecular weight of 307.17 g/mol, XLogP of 1.72, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(bromomethyl)-7-methylsulfonyl-4H-1,3-benzodioxine is sourced from PubChem (CID 66886440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).