About 3-bromo-4-[(5S)-6,7-dihydro-5H-pyrrolo[1,2-c]imidazol-5-yl]benzonitrile
3-bromo-4-[(5S)-6,7-dihydro-5H-pyrrolo[1,2-c]imidazol-5-yl]benzonitrile (PubChem CID 66886510) has the molecular formula C13H10BrN3
and a molecular weight of 288.15 g/mol. Its IUPAC name is 3-bromo-4-[(5S)-6,7-dihydro-5H-pyrrolo[1,2-c]imidazol-5-yl]benzonitrile.
Molecular Properties
| Compound Name | 3-bromo-4-[(5S)-6,7-dihydro-5H-pyrrolo[1,2-c]imidazol-5-yl]benzonitrile |
| PubChem CID | 66886510 |
| Molecular Formula | C13H10BrN3 |
| Molecular Weight | 288.15 g/mol |
| Exact Mass | 287.01 |
| IUPAC Name | 3-bromo-4-[(5S)-6,7-dihydro-5H-pyrrolo[1,2-c]imidazol-5-yl]benzonitrile |
| SMILES | N#Cc1ccc([C@@H]2CCc3cncn32)c(Br)c1 |
| InChI | InChI=1S/C13H10BrN3/c14-12-5-9(6-15)1-3-11(12)13-4-2-10-7-16-8-17(10)13/h1,3,5,7-8,13H,2,4H2/t13-/m0/s1 |
| InChIKey | FLRGANPHGAPABO-ZDUSSCGKSA-N |
| XLogP | 3.05 |
| TPSA | 41.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.15 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-bromo-4-[(5S)-6,7-dihydro-5H-pyrrolo[1,2-c]imidazol-5-yl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-4-[(5S)-6,7-dihydro-5H-pyrrolo[1,2-c]imidazol-5-yl]benzonitrile?
The IUPAC name of 3-bromo-4-[(5S)-6,7-dihydro-5H-pyrrolo[1,2-c]imidazol-5-yl]benzonitrile (CID 66886510) is 3-bromo-4-[(5S)-6,7-dihydro-5H-pyrrolo[1,2-c]imidazol-5-yl]benzonitrile.
What is the SMILES notation for 3-bromo-4-[(5S)-6,7-dihydro-5H-pyrrolo[1,2-c]imidazol-5-yl]benzonitrile?
The canonical SMILES for 3-bromo-4-[(5S)-6,7-dihydro-5H-pyrrolo[1,2-c]imidazol-5-yl]benzonitrile is N#Cc1ccc([C@@H]2CCc3cncn32)c(Br)c1.
What is the InChIKey of 3-bromo-4-[(5S)-6,7-dihydro-5H-pyrrolo[1,2-c]imidazol-5-yl]benzonitrile?
The InChIKey is FLRGANPHGAPABO-ZDUSSCGKSA-N. The full InChI is InChI=1S/C13H10BrN3/c14-12-5-9(6-15)1-3-11(12)13-4-2-10-7-16-8-17(10)13/h1,3,5,7-8,13H,2,4H2/t13-/m0/s1.
What are the key properties of 3-bromo-4-[(5S)-6,7-dihydro-5H-pyrrolo[1,2-c]imidazol-5-yl]benzonitrile?
3-bromo-4-[(5S)-6,7-dihydro-5H-pyrrolo[1,2-c]imidazol-5-yl]benzonitrile has a molecular weight of 288.15 g/mol, XLogP of 3.05, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-4-[(5S)-6,7-dihydro-5H-pyrrolo[1,2-c]imidazol-5-yl]benzonitrile is sourced from PubChem (CID 66886510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).