C18H25N3OS — CID 66886674
3,4,4a,5,6,7-hexahydro-2H-quinolin-1-yl-(2-piperidin-4-yl-1,3-thiazol-4-yl)methanone (PubChem CID 66886674) has the molecular formula C18H25N3OS and a molecular weight of 331.49 g/mol. Its IUPAC name is 3,4,4a,5,6,7-hexahydro-2H-quinolin-1-yl-(2-piperidin-4-yl-1,3-thiazol-4-yl)methanone.
| Compound Name | 3,4,4a,5,6,7-hexahydro-2H-quinolin-1-yl-(2-piperidin-4-yl-1,3-thiazol-4-yl)methanone |
|---|---|
| PubChem CID | 66886674 |
| Molecular Formula | C18H25N3OS |
| Molecular Weight | 331.49 g/mol |
| Exact Mass | 331.17 |
| IUPAC Name | 3,4,4a,5,6,7-hexahydro-2H-quinolin-1-yl-(2-piperidin-4-yl-1,3-thiazol-4-yl)methanone |
| SMILES | O=C(c1csc(C2CCNCC2)n1)N1CCCC2CCCC=C21 |
| InChI | InChI=1S/C18H25N3OS/c22-18(21-11-3-5-13-4-1-2-6-16(13)21)15-12-23-17(20-15)14-7-9-19-10-8-14/h6,12-14,19H,1-5,7-11H2 |
| InChIKey | DZHRUOSWXOYHFY-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.49 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |