About bis(pyrrole-2,5-dione);2H-thiazine
bis(pyrrole-2,5-dione);2H-thiazine (PubChem CID 66886793) has the molecular formula C12H11N3O4S
and a molecular weight of 293.30 g/mol. Its IUPAC name is bis(pyrrole-2,5-dione);2H-thiazine.
Molecular Properties
| Compound Name | bis(pyrrole-2,5-dione);2H-thiazine |
| PubChem CID | 66886793 |
| Molecular Formula | C12H11N3O4S |
| Molecular Weight | 293.30 g/mol |
| Exact Mass | 293.05 |
| IUPAC Name | bis(pyrrole-2,5-dione);2H-thiazine |
| SMILES | C1=CNSC=C1.O=C1C=CC(=O)N1.O=C1C=CC(=O)N1 |
| InChI | InChI=1S/2C4H3NO2.C4H5NS/c2*6-3-1-2-4(7)5-3;1-2-4-6-5-3-1/h2*1-2H,(H,5,6,7);1-5H |
| InChIKey | TYUPFDFOPNXMQN-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.30 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze bis(pyrrole-2,5-dione);2H-thiazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(pyrrole-2,5-dione);2H-thiazine?
The IUPAC name of bis(pyrrole-2,5-dione);2H-thiazine (CID 66886793) is bis(pyrrole-2,5-dione);2H-thiazine.
What is the SMILES notation for bis(pyrrole-2,5-dione);2H-thiazine?
The canonical SMILES for bis(pyrrole-2,5-dione);2H-thiazine is C1=CNSC=C1.O=C1C=CC(=O)N1.O=C1C=CC(=O)N1.
What is the InChIKey of bis(pyrrole-2,5-dione);2H-thiazine?
The InChIKey is TYUPFDFOPNXMQN-UHFFFAOYSA-N. The full InChI is InChI=1S/2C4H3NO2.C4H5NS/c2*6-3-1-2-4(7)5-3;1-2-4-6-5-3-1/h2*1-2H,(H,5,6,7);1-5H.
What are the key properties of bis(pyrrole-2,5-dione);2H-thiazine?
bis(pyrrole-2,5-dione);2H-thiazine has a molecular weight of 293.30 g/mol, XLogP of -0.34, 0 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(pyrrole-2,5-dione);2H-thiazine is sourced from PubChem (CID 66886793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).