C39H36FN5O5S — CID 66886836
4-[6-[(2-cyano-5-fluoro-1,3-benzothiazol-6-yl)oxy]hexylcarbamoyl]-2-[3-(dimethylamino)-6-dimethylazaniumylidenexanthen-9-yl]benzoate (PubChem CID 66886836) has the molecular formula C39H36FN5O5S and a molecular weight of 705.81 g/mol. Its IUPAC name is 4-[6-[(2-cyano-5-fluoro-1,3-benzothiazol-6-yl)oxy]hexylcarbamoyl]-2-[3-(dimethylamino)-6-dimethylazaniumylidenexanthen-9-yl]benzoate.
| Compound Name | 4-[6-[(2-cyano-5-fluoro-1,3-benzothiazol-6-yl)oxy]hexylcarbamoyl]-2-[3-(dimethylamino)-6-dimethylazaniumylidenexanthen-9-yl]benzoate |
|---|---|
| PubChem CID | 66886836 |
| Molecular Formula | C39H36FN5O5S |
| Molecular Weight | 705.81 g/mol |
| Exact Mass | 705.24 |
| IUPAC Name | 4-[6-[(2-cyano-5-fluoro-1,3-benzothiazol-6-yl)oxy]hexylcarbamoyl]-2-[3-(dimethylamino)-6-dimethylazaniumylidenexanthen-9-yl]benzoate |
| SMILES | CN(C)c1ccc2c(-c3cc(C(=O)NCCCCCCOc4cc5sc(C#N)nc5cc4F)ccc3C(=O)[O-])c3ccc(=[N+](C)C)cc-3oc2c1 |
| InChI | InChI=1S/C39H36FN5O5S/c1-44(2)24-10-13-27-32(18-24)50-33-19-25(45(3)4)11-14-28(33)37(27)29-17-23(9-12-26(29)39(47)48)38(46)42-15-7-5-6-8-16-49-34-21-35-31(20-30(34)40)43-36(22-41)51-35/h9-14,17-21H,5-8,15-16H2,1-4H3,(H-,42,46,47,48) |
| InChIKey | VOSBFIKMLYSBEA-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 134.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.81 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|