C39H37FN5O5S+ — CID 66886837
[9-[2-carboxy-5-[6-[(2-cyano-5-fluoro-1,3-benzothiazol-6-yl)oxy]hexylcarbamoyl]phenyl]-6-(dimethylamino)xanthen-3-ylidene]-dimethylazanium (PubChem CID 66886837) has the molecular formula C39H37FN5O5S+ and a molecular weight of 706.82 g/mol. Its IUPAC name is [9-[2-carboxy-5-[6-[(2-cyano-5-fluoro-1,3-benzothiazol-6-yl)oxy]hexylcarbamoyl]phenyl]-6-(dimethylamino)xanthen-3-ylidene]-dimethylazanium.
| Compound Name | [9-[2-carboxy-5-[6-[(2-cyano-5-fluoro-1,3-benzothiazol-6-yl)oxy]hexylcarbamoyl]phenyl]-6-(dimethylamino)xanthen-3-ylidene]-dimethylazanium |
|---|---|
| PubChem CID | 66886837 |
| Molecular Formula | C39H37FN5O5S+ |
| Molecular Weight | 706.82 g/mol |
| Exact Mass | 706.25 |
| IUPAC Name | [9-[2-carboxy-5-[6-[(2-cyano-5-fluoro-1,3-benzothiazol-6-yl)oxy]hexylcarbamoyl]phenyl]-6-(dimethylamino)xanthen-3-ylidene]-dimethylazanium |
| SMILES | CN(C)c1ccc2c(-c3cc(C(=O)NCCCCCCOc4cc5sc(C#N)nc5cc4F)ccc3C(=O)O)c3ccc(=[N+](C)C)cc-3oc2c1 |
| InChI | InChI=1S/C39H36FN5O5S/c1-44(2)24-10-13-27-32(18-24)50-33-19-25(45(3)4)11-14-28(33)37(27)29-17-23(9-12-26(29)39(47)48)38(46)42-15-7-5-6-8-16-49-34-21-35-31(20-30(34)40)43-36(22-41)51-35/h9-14,17-21H,5-8,15-16H2,1-4H3,(H-,42,46,47,48)/p+1 |
| InChIKey | VOSBFIKMLYSBEA-UHFFFAOYSA-O |
| XLogP | 6.99 |
| TPSA | 131.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.82 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|