C25H39N3OS — CID 66887045
3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl-[2-[1-(cyclohexylmethyl)piperidin-4-yl]-1,3-thiazol-4-yl]methanone (PubChem CID 66887045) has the molecular formula C25H39N3OS and a molecular weight of 429.67 g/mol. Its IUPAC name is 3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl-[2-[1-(cyclohexylmethyl)piperidin-4-yl]-1,3-thiazol-4-yl]methanone.
| Compound Name | 3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl-[2-[1-(cyclohexylmethyl)piperidin-4-yl]-1,3-thiazol-4-yl]methanone |
|---|---|
| PubChem CID | 66887045 |
| Molecular Formula | C25H39N3OS |
| Molecular Weight | 429.67 g/mol |
| Exact Mass | 429.28 |
| IUPAC Name | 3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl-[2-[1-(cyclohexylmethyl)piperidin-4-yl]-1,3-thiazol-4-yl]methanone |
| SMILES | O=C(c1csc(C2CCN(CC3CCCCC3)CC2)n1)N1CCCC2CCCCC21 |
| InChI | InChI=1S/C25H39N3OS/c29-25(28-14-6-10-20-9-4-5-11-23(20)28)22-18-30-24(26-22)21-12-15-27(16-13-21)17-19-7-2-1-3-8-19/h18-21,23H,1-17H2 |
| InChIKey | TXMRHEIMAWGRAE-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.67 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |