About [(3S)-6-fluoro-2,3-dihydro-1,4-benzodioxin-3-yl]methanol
[(3S)-6-fluoro-2,3-dihydro-1,4-benzodioxin-3-yl]methanol (PubChem CID 66887115) has the molecular formula C9H9FO3
and a molecular weight of 184.17 g/mol. Its IUPAC name is [(3S)-6-fluoro-2,3-dihydro-1,4-benzodioxin-3-yl]methanol.
Molecular Properties
| Compound Name | [(3S)-6-fluoro-2,3-dihydro-1,4-benzodioxin-3-yl]methanol |
| PubChem CID | 66887115 |
| Molecular Formula | C9H9FO3 |
| Molecular Weight | 184.17 g/mol |
| Exact Mass | 184.05 |
| IUPAC Name | [(3S)-6-fluoro-2,3-dihydro-1,4-benzodioxin-3-yl]methanol |
| SMILES | OC[C@H]1COc2ccc(F)cc2O1 |
| InChI | InChI=1S/C9H9FO3/c10-6-1-2-8-9(3-6)13-7(4-11)5-12-8/h1-3,7,11H,4-5H2/t7-/m0/s1 |
| InChIKey | BPCKRFYVGGIWHV-ZETCQYMHSA-N |
| XLogP | 0.96 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.17 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(3S)-6-fluoro-2,3-dihydro-1,4-benzodioxin-3-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S)-6-fluoro-2,3-dihydro-1,4-benzodioxin-3-yl]methanol?
The IUPAC name of [(3S)-6-fluoro-2,3-dihydro-1,4-benzodioxin-3-yl]methanol (CID 66887115) is [(3S)-6-fluoro-2,3-dihydro-1,4-benzodioxin-3-yl]methanol.
What is the SMILES notation for [(3S)-6-fluoro-2,3-dihydro-1,4-benzodioxin-3-yl]methanol?
The canonical SMILES for [(3S)-6-fluoro-2,3-dihydro-1,4-benzodioxin-3-yl]methanol is OC[C@H]1COc2ccc(F)cc2O1.
What is the InChIKey of [(3S)-6-fluoro-2,3-dihydro-1,4-benzodioxin-3-yl]methanol?
The InChIKey is BPCKRFYVGGIWHV-ZETCQYMHSA-N. The full InChI is InChI=1S/C9H9FO3/c10-6-1-2-8-9(3-6)13-7(4-11)5-12-8/h1-3,7,11H,4-5H2/t7-/m0/s1.
What are the key properties of [(3S)-6-fluoro-2,3-dihydro-1,4-benzodioxin-3-yl]methanol?
[(3S)-6-fluoro-2,3-dihydro-1,4-benzodioxin-3-yl]methanol has a molecular weight of 184.17 g/mol, XLogP of 0.96, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S)-6-fluoro-2,3-dihydro-1,4-benzodioxin-3-yl]methanol is sourced from PubChem (CID 66887115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).