About methyl 1-[(2,4-difluorophenyl)methyl]-6-(hydroxymethyl)indazole-3-carboxylate
methyl 1-[(2,4-difluorophenyl)methyl]-6-(hydroxymethyl)indazole-3-carboxylate (PubChem CID 66888106) has the molecular formula C17H14F2N2O3
and a molecular weight of 332.31 g/mol. Its IUPAC name is methyl 1-[(2,4-difluorophenyl)methyl]-6-(hydroxymethyl)indazole-3-carboxylate.
Molecular Properties
| Compound Name | methyl 1-[(2,4-difluorophenyl)methyl]-6-(hydroxymethyl)indazole-3-carboxylate |
| PubChem CID | 66888106 |
| Molecular Formula | C17H14F2N2O3 |
| Molecular Weight | 332.31 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | methyl 1-[(2,4-difluorophenyl)methyl]-6-(hydroxymethyl)indazole-3-carboxylate |
| SMILES | COC(=O)c1nn(Cc2ccc(F)cc2F)c2cc(CO)ccc12 |
| InChI | InChI=1S/C17H14F2N2O3/c1-24-17(23)16-13-5-2-10(9-22)6-15(13)21(20-16)8-11-3-4-12(18)7-14(11)19/h2-7,22H,8-9H2,1H3 |
| InChIKey | BBJLNMYFJOYAOD-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.31 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 1-[(2,4-difluorophenyl)methyl]-6-(hydroxymethyl)indazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1-[(2,4-difluorophenyl)methyl]-6-(hydroxymethyl)indazole-3-carboxylate?
The IUPAC name of methyl 1-[(2,4-difluorophenyl)methyl]-6-(hydroxymethyl)indazole-3-carboxylate (CID 66888106) is methyl 1-[(2,4-difluorophenyl)methyl]-6-(hydroxymethyl)indazole-3-carboxylate.
What is the SMILES notation for methyl 1-[(2,4-difluorophenyl)methyl]-6-(hydroxymethyl)indazole-3-carboxylate?
The canonical SMILES for methyl 1-[(2,4-difluorophenyl)methyl]-6-(hydroxymethyl)indazole-3-carboxylate is COC(=O)c1nn(Cc2ccc(F)cc2F)c2cc(CO)ccc12.
What is the InChIKey of methyl 1-[(2,4-difluorophenyl)methyl]-6-(hydroxymethyl)indazole-3-carboxylate?
The InChIKey is BBJLNMYFJOYAOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14F2N2O3/c1-24-17(23)16-13-5-2-10(9-22)6-15(13)21(20-16)8-11-3-4-12(18)7-14(11)19/h2-7,22H,8-9H2,1H3.
What are the key properties of methyl 1-[(2,4-difluorophenyl)methyl]-6-(hydroxymethyl)indazole-3-carboxylate?
methyl 1-[(2,4-difluorophenyl)methyl]-6-(hydroxymethyl)indazole-3-carboxylate has a molecular weight of 332.31 g/mol, XLogP of 2.64, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-[(2,4-difluorophenyl)methyl]-6-(hydroxymethyl)indazole-3-carboxylate is sourced from PubChem (CID 66888106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).