About 10-azatricyclo[6.2.1.01,6]undeca-2,4,7,9-tetraene
10-azatricyclo[6.2.1.01,6]undeca-2,4,7,9-tetraene (PubChem CID 66888262) has the molecular formula C10H9N
and a molecular weight of 143.19 g/mol. Its IUPAC name is 10-azatricyclo[6.2.1.01,6]undeca-2,4,7,9-tetraene.
Analyze 10-azatricyclo[6.2.1.01,6]undeca-2,4,7,9-tetraene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-azatricyclo[6.2.1.01,6]undeca-2,4,7,9-tetraene?
The IUPAC name of 10-azatricyclo[6.2.1.01,6]undeca-2,4,7,9-tetraene (CID 66888262) is 10-azatricyclo[6.2.1.01,6]undeca-2,4,7,9-tetraene.
What is the SMILES notation for 10-azatricyclo[6.2.1.01,6]undeca-2,4,7,9-tetraene?
The canonical SMILES for 10-azatricyclo[6.2.1.01,6]undeca-2,4,7,9-tetraene is C1=CC2C=C3C=NC2(C=C1)C3.
What is the InChIKey of 10-azatricyclo[6.2.1.01,6]undeca-2,4,7,9-tetraene?
The InChIKey is HMNUFYPRFVLOJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N/c1-2-4-10-6-8(7-11-10)5-9(10)3-1/h1-5,7,9H,6H2.
What are the key properties of 10-azatricyclo[6.2.1.01,6]undeca-2,4,7,9-tetraene?
10-azatricyclo[6.2.1.01,6]undeca-2,4,7,9-tetraene has a molecular weight of 143.19 g/mol, XLogP of 1.88, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 10-azatricyclo[6.2.1.01,6]undeca-2,4,7,9-tetraene is sourced from PubChem (CID 66888262), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).