About 6-(2-phenoxyphenyl)-8-(4-piperidin-4-ylanilino)-2H-2,7-naphthyridin-1-one
6-(2-phenoxyphenyl)-8-(4-piperidin-4-ylanilino)-2H-2,7-naphthyridin-1-one (PubChem CID 66888438) has the molecular formula C31H28N4O2
and a molecular weight of 488.59 g/mol. Its IUPAC name is 6-(2-phenoxyphenyl)-8-(4-piperidin-4-ylanilino)-2H-2,7-naphthyridin-1-one.
Molecular Properties
| Compound Name | 6-(2-phenoxyphenyl)-8-(4-piperidin-4-ylanilino)-2H-2,7-naphthyridin-1-one |
| PubChem CID | 66888438 |
| Molecular Formula | C31H28N4O2 |
| Molecular Weight | 488.59 g/mol |
| Exact Mass | 488.22 |
| IUPAC Name | 6-(2-phenoxyphenyl)-8-(4-piperidin-4-ylanilino)-2H-2,7-naphthyridin-1-one |
| SMILES | O=c1[nH]ccc2cc(-c3ccccc3Oc3ccccc3)nc(Nc3ccc(C4CCNCC4)cc3)c12 |
| InChI | InChI=1S/C31H28N4O2/c36-31-29-23(16-19-33-31)20-27(26-8-4-5-9-28(26)37-25-6-2-1-3-7-25)35-30(29)34-24-12-10-21(11-13-24)22-14-17-32-18-15-22/h1-13,16,19-20,22,32H,14-15,17-18H2,(H,33,36)(H,34,35) |
| InChIKey | SFEVPOWDFFBPTE-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 79.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 488.59 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-(2-phenoxyphenyl)-8-(4-piperidin-4-ylanilino)-2H-2,7-naphthyridin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2-phenoxyphenyl)-8-(4-piperidin-4-ylanilino)-2H-2,7-naphthyridin-1-one?
The IUPAC name of 6-(2-phenoxyphenyl)-8-(4-piperidin-4-ylanilino)-2H-2,7-naphthyridin-1-one (CID 66888438) is 6-(2-phenoxyphenyl)-8-(4-piperidin-4-ylanilino)-2H-2,7-naphthyridin-1-one.
What is the SMILES notation for 6-(2-phenoxyphenyl)-8-(4-piperidin-4-ylanilino)-2H-2,7-naphthyridin-1-one?
The canonical SMILES for 6-(2-phenoxyphenyl)-8-(4-piperidin-4-ylanilino)-2H-2,7-naphthyridin-1-one is O=c1[nH]ccc2cc(-c3ccccc3Oc3ccccc3)nc(Nc3ccc(C4CCNCC4)cc3)c12.
What is the InChIKey of 6-(2-phenoxyphenyl)-8-(4-piperidin-4-ylanilino)-2H-2,7-naphthyridin-1-one?
The InChIKey is SFEVPOWDFFBPTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H28N4O2/c36-31-29-23(16-19-33-31)20-27(26-8-4-5-9-28(26)37-25-6-2-1-3-7-25)35-30(29)34-24-12-10-21(11-13-24)22-14-17-32-18-15-22/h1-13,16,19-20,22,32H,14-15,17-18H2,(H,33,36)(H,34,35).
What are the key properties of 6-(2-phenoxyphenyl)-8-(4-piperidin-4-ylanilino)-2H-2,7-naphthyridin-1-one?
6-(2-phenoxyphenyl)-8-(4-piperidin-4-ylanilino)-2H-2,7-naphthyridin-1-one has a molecular weight of 488.59 g/mol, XLogP of 6.59, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2-phenoxyphenyl)-8-(4-piperidin-4-ylanilino)-2H-2,7-naphthyridin-1-one is sourced from PubChem (CID 66888438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).