C21H27N3O2 — CID 66889253
N-[(1-benzylpiperidin-2-yl)methyl]-4,5-dimethyl-2-nitroaniline (PubChem CID 66889253) has the molecular formula C21H27N3O2 and a molecular weight of 353.47 g/mol. Its IUPAC name is N-[(1-benzylpiperidin-2-yl)methyl]-4,5-dimethyl-2-nitroaniline.
| Compound Name | N-[(1-benzylpiperidin-2-yl)methyl]-4,5-dimethyl-2-nitroaniline |
|---|---|
| PubChem CID | 66889253 |
| Molecular Formula | C21H27N3O2 |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.21 |
| IUPAC Name | N-[(1-benzylpiperidin-2-yl)methyl]-4,5-dimethyl-2-nitroaniline |
| SMILES | Cc1cc(NCC2CCCCN2Cc2ccccc2)c([N+](=O)[O-])cc1C |
| InChI | InChI=1S/C21H27N3O2/c1-16-12-20(21(24(25)26)13-17(16)2)22-14-19-10-6-7-11-23(19)15-18-8-4-3-5-9-18/h3-5,8-9,12-13,19,22H,6-7,10-11,14-15H2,1-2H3 |
| InChIKey | IHWVBNGGSBWXIC-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 58.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|