About CID 66890061
CID 66890061 (PubChem CID 66890061) has the molecular formula C8H16Si
and a molecular weight of 140.30 g/mol.
Molecular Properties
| Compound Name | CID 66890061 |
| PubChem CID | 66890061 |
| Molecular Formula | C8H16Si |
| Molecular Weight | 140.30 g/mol |
| Exact Mass | 140.10 |
| IUPAC Name | — |
| SMILES | C[Si]C1(C)CCCCC1 |
| InChI | InChI=1S/C8H16Si/c1-8(9-2)6-4-3-5-7-8/h3-7H2,1-2H3 |
| InChIKey | JYQOAASHKFJAME-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.30 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 66890061 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 66890061?
The IUPAC name of CID 66890061 (CID 66890061) is not available.
What is the SMILES notation for CID 66890061?
The canonical SMILES for CID 66890061 is C[Si]C1(C)CCCCC1.
What is the InChIKey of CID 66890061?
The InChIKey is JYQOAASHKFJAME-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16Si/c1-8(9-2)6-4-3-5-7-8/h3-7H2,1-2H3.
What are the key properties of CID 66890061?
CID 66890061 has a molecular weight of 140.30 g/mol, XLogP of 2.88, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 66890061 is sourced from PubChem (CID 66890061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).