C18H20N2O8S — CID 66890232
[(2S,3R,4S,5S)-2-(2,4-dioxopyrimidin-1-yl)-4-hydroxy-5-(hydroxymethyl)thiolan-3-yl] 2,4-dimethoxybenzoate (PubChem CID 66890232) has the molecular formula C18H20N2O8S and a molecular weight of 424.43 g/mol. Its IUPAC name is [(2S,3R,4S,5S)-2-(2,4-dioxopyrimidin-1-yl)-4-hydroxy-5-(hydroxymethyl)thiolan-3-yl] 2,4-dimethoxybenzoate.
| Compound Name | [(2S,3R,4S,5S)-2-(2,4-dioxopyrimidin-1-yl)-4-hydroxy-5-(hydroxymethyl)thiolan-3-yl] 2,4-dimethoxybenzoate |
|---|---|
| PubChem CID | 66890232 |
| Molecular Formula | C18H20N2O8S |
| Molecular Weight | 424.43 g/mol |
| Exact Mass | 424.09 |
| IUPAC Name | [(2S,3R,4S,5S)-2-(2,4-dioxopyrimidin-1-yl)-4-hydroxy-5-(hydroxymethyl)thiolan-3-yl] 2,4-dimethoxybenzoate |
| SMILES | COc1ccc(C(=O)O[C@@H]2[C@H](O)[C@H](CO)S[C@@H]2n2ccc(=O)[nH]c2=O)c(OC)c1 |
| InChI | InChI=1S/C18H20N2O8S/c1-26-9-3-4-10(11(7-9)27-2)17(24)28-15-14(23)12(8-21)29-16(15)20-6-5-13(22)19-18(20)25/h3-7,12,14-16,21,23H,8H2,1-2H3,(H,19,22,25)/t12-,14+,15+,16-/m0/s1 |
| InChIKey | CFBHHXYZGNTLNJ-XZDPQHSOSA-N |
| XLogP | -0.25 |
| TPSA | 140.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.43 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |