About 2-(2,5-dioxopyrrol-1-yl)acetic acid;1-hydroxypyrrolidine-2,5-dione
2-(2,5-dioxopyrrol-1-yl)acetic acid;1-hydroxypyrrolidine-2,5-dione (PubChem CID 66890451) has the molecular formula C10H10N2O7
and a molecular weight of 270.20 g/mol. Its IUPAC name is 2-(2,5-dioxopyrrol-1-yl)acetic acid;1-hydroxypyrrolidine-2,5-dione.
Molecular Properties
| Compound Name | 2-(2,5-dioxopyrrol-1-yl)acetic acid;1-hydroxypyrrolidine-2,5-dione |
| PubChem CID | 66890451 |
| Molecular Formula | C10H10N2O7 |
| Molecular Weight | 270.20 g/mol |
| Exact Mass | 270.05 |
| IUPAC Name | 2-(2,5-dioxopyrrol-1-yl)acetic acid;1-hydroxypyrrolidine-2,5-dione |
| SMILES | O=C(O)CN1C(=O)C=CC1=O.O=C1CCC(=O)N1O |
| InChI | InChI=1S/C6H5NO4.C4H5NO3/c8-4-1-2-5(9)7(4)3-6(10)11;6-3-1-2-4(7)5(3)8/h1-2H,3H2,(H,10,11);8H,1-2H2 |
| InChIKey | PUEWREFAXIQYDS-UHFFFAOYSA-N |
| XLogP | -1.48 |
| TPSA | 132.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.20 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,5-dioxopyrrol-1-yl)acetic acid;1-hydroxypyrrolidine-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,5-dioxopyrrol-1-yl)acetic acid;1-hydroxypyrrolidine-2,5-dione?
The IUPAC name of 2-(2,5-dioxopyrrol-1-yl)acetic acid;1-hydroxypyrrolidine-2,5-dione (CID 66890451) is 2-(2,5-dioxopyrrol-1-yl)acetic acid;1-hydroxypyrrolidine-2,5-dione.
What is the SMILES notation for 2-(2,5-dioxopyrrol-1-yl)acetic acid;1-hydroxypyrrolidine-2,5-dione?
The canonical SMILES for 2-(2,5-dioxopyrrol-1-yl)acetic acid;1-hydroxypyrrolidine-2,5-dione is O=C(O)CN1C(=O)C=CC1=O.O=C1CCC(=O)N1O.
What is the InChIKey of 2-(2,5-dioxopyrrol-1-yl)acetic acid;1-hydroxypyrrolidine-2,5-dione?
The InChIKey is PUEWREFAXIQYDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5NO4.C4H5NO3/c8-4-1-2-5(9)7(4)3-6(10)11;6-3-1-2-4(7)5(3)8/h1-2H,3H2,(H,10,11);8H,1-2H2.
What are the key properties of 2-(2,5-dioxopyrrol-1-yl)acetic acid;1-hydroxypyrrolidine-2,5-dione?
2-(2,5-dioxopyrrol-1-yl)acetic acid;1-hydroxypyrrolidine-2,5-dione has a molecular weight of 270.20 g/mol, XLogP of -1.48, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,5-dioxopyrrol-1-yl)acetic acid;1-hydroxypyrrolidine-2,5-dione is sourced from PubChem (CID 66890451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).