About 2-(3-bromophenyl)bicyclo[4.2.0]octa-1(6),2,4,7-tetraene
2-(3-bromophenyl)bicyclo[4.2.0]octa-1(6),2,4,7-tetraene (PubChem CID 66890486) has the molecular formula C14H9Br
and a molecular weight of 257.13 g/mol. Its IUPAC name is 2-(3-bromophenyl)bicyclo[4.2.0]octa-1(6),2,4,7-tetraene.
Molecular Properties
| Compound Name | 2-(3-bromophenyl)bicyclo[4.2.0]octa-1(6),2,4,7-tetraene |
| PubChem CID | 66890486 |
| Molecular Formula | C14H9Br |
| Molecular Weight | 257.13 g/mol |
| Exact Mass | 255.99 |
| IUPAC Name | 2-(3-bromophenyl)bicyclo[4.2.0]octa-1(6),2,4,7-tetraene |
| SMILES | Brc1cccc(-c2cccc3c2C=C3)c1 |
| InChI | InChI=1S/C14H9Br/c15-12-5-1-4-11(9-12)13-6-2-3-10-7-8-14(10)13/h1-9H |
| InChIKey | ZBOSWMWAKWXESK-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.13 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-(3-bromophenyl)bicyclo[4.2.0]octa-1(6),2,4,7-tetraene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-bromophenyl)bicyclo[4.2.0]octa-1(6),2,4,7-tetraene?
The IUPAC name of 2-(3-bromophenyl)bicyclo[4.2.0]octa-1(6),2,4,7-tetraene (CID 66890486) is 2-(3-bromophenyl)bicyclo[4.2.0]octa-1(6),2,4,7-tetraene.
What is the SMILES notation for 2-(3-bromophenyl)bicyclo[4.2.0]octa-1(6),2,4,7-tetraene?
The canonical SMILES for 2-(3-bromophenyl)bicyclo[4.2.0]octa-1(6),2,4,7-tetraene is Brc1cccc(-c2cccc3c2C=C3)c1.
What is the InChIKey of 2-(3-bromophenyl)bicyclo[4.2.0]octa-1(6),2,4,7-tetraene?
The InChIKey is ZBOSWMWAKWXESK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9Br/c15-12-5-1-4-11(9-12)13-6-2-3-10-7-8-14(10)13/h1-9H.
What are the key properties of 2-(3-bromophenyl)bicyclo[4.2.0]octa-1(6),2,4,7-tetraene?
2-(3-bromophenyl)bicyclo[4.2.0]octa-1(6),2,4,7-tetraene has a molecular weight of 257.13 g/mol, XLogP of 4.60, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-bromophenyl)bicyclo[4.2.0]octa-1(6),2,4,7-tetraene is sourced from PubChem (CID 66890486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).