C21H31N3O4S — CID 66891638
N-[(2R,3S)-3-amino-2-hydroxy-4-phenylbutyl]-4-hydroxy-3-(methylamino)-N-(2-methylpropyl)benzenesulfonamide (PubChem CID 66891638) has the molecular formula C21H31N3O4S and a molecular weight of 421.56 g/mol. Its IUPAC name is N-[(2R,3S)-3-amino-2-hydroxy-4-phenylbutyl]-4-hydroxy-3-(methylamino)-N-(2-methylpropyl)benzenesulfonamide.
| Compound Name | N-[(2R,3S)-3-amino-2-hydroxy-4-phenylbutyl]-4-hydroxy-3-(methylamino)-N-(2-methylpropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 66891638 |
| Molecular Formula | C21H31N3O4S |
| Molecular Weight | 421.56 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | N-[(2R,3S)-3-amino-2-hydroxy-4-phenylbutyl]-4-hydroxy-3-(methylamino)-N-(2-methylpropyl)benzenesulfonamide |
| SMILES | CNc1cc(S(=O)(=O)N(CC(C)C)C[C@@H](O)[C@@H](N)Cc2ccccc2)ccc1O |
| InChI | InChI=1S/C21H31N3O4S/c1-15(2)13-24(14-21(26)18(22)11-16-7-5-4-6-8-16)29(27,28)17-9-10-20(25)19(12-17)23-3/h4-10,12,15,18,21,23,25-26H,11,13-14,22H2,1-3H3/t18-,21+/m0/s1 |
| InChIKey | XZWNYMWFPZQZKG-GHTZIAJQSA-N |
| XLogP | 2.01 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.56 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|