About (3S)-3-[(1S)-1-(3,6-dichloro-2-fluorophenoxy)-3-methylbutyl]pyrrolidine
(3S)-3-[(1S)-1-(3,6-dichloro-2-fluorophenoxy)-3-methylbutyl]pyrrolidine (PubChem CID 66892178) has the molecular formula C15H20Cl2FNO
and a molecular weight of 320.24 g/mol. Its IUPAC name is (3S)-3-[(1S)-1-(3,6-dichloro-2-fluorophenoxy)-3-methylbutyl]pyrrolidine.
Molecular Properties
| Compound Name | (3S)-3-[(1S)-1-(3,6-dichloro-2-fluorophenoxy)-3-methylbutyl]pyrrolidine |
| PubChem CID | 66892178 |
| Molecular Formula | C15H20Cl2FNO |
| Molecular Weight | 320.24 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | (3S)-3-[(1S)-1-(3,6-dichloro-2-fluorophenoxy)-3-methylbutyl]pyrrolidine |
| SMILES | CC(C)C[C@H](Oc1c(Cl)ccc(Cl)c1F)[C@H]1CCNC1 |
| InChI | InChI=1S/C15H20Cl2FNO/c1-9(2)7-13(10-5-6-19-8-10)20-15-12(17)4-3-11(16)14(15)18/h3-4,9-10,13,19H,5-8H2,1-2H3/t10-,13-/m0/s1 |
| InChIKey | XESITJJMPPTAEI-GWCFXTLKSA-N |
| XLogP | 4.54 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.24 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze (3S)-3-[(1S)-1-(3,6-dichloro-2-fluorophenoxy)-3-methylbutyl]pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-[(1S)-1-(3,6-dichloro-2-fluorophenoxy)-3-methylbutyl]pyrrolidine?
The IUPAC name of (3S)-3-[(1S)-1-(3,6-dichloro-2-fluorophenoxy)-3-methylbutyl]pyrrolidine (CID 66892178) is (3S)-3-[(1S)-1-(3,6-dichloro-2-fluorophenoxy)-3-methylbutyl]pyrrolidine.
What is the SMILES notation for (3S)-3-[(1S)-1-(3,6-dichloro-2-fluorophenoxy)-3-methylbutyl]pyrrolidine?
The canonical SMILES for (3S)-3-[(1S)-1-(3,6-dichloro-2-fluorophenoxy)-3-methylbutyl]pyrrolidine is CC(C)C[C@H](Oc1c(Cl)ccc(Cl)c1F)[C@H]1CCNC1.
What is the InChIKey of (3S)-3-[(1S)-1-(3,6-dichloro-2-fluorophenoxy)-3-methylbutyl]pyrrolidine?
The InChIKey is XESITJJMPPTAEI-GWCFXTLKSA-N. The full InChI is InChI=1S/C15H20Cl2FNO/c1-9(2)7-13(10-5-6-19-8-10)20-15-12(17)4-3-11(16)14(15)18/h3-4,9-10,13,19H,5-8H2,1-2H3/t10-,13-/m0/s1.
What are the key properties of (3S)-3-[(1S)-1-(3,6-dichloro-2-fluorophenoxy)-3-methylbutyl]pyrrolidine?
(3S)-3-[(1S)-1-(3,6-dichloro-2-fluorophenoxy)-3-methylbutyl]pyrrolidine has a molecular weight of 320.24 g/mol, XLogP of 4.54, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-[(1S)-1-(3,6-dichloro-2-fluorophenoxy)-3-methylbutyl]pyrrolidine is sourced from PubChem (CID 66892178), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).