About tert-butyl 3-[(S)-(4,4-difluorocyclohexyl)-hydroxymethyl]pyrrolidine-1-carboxylate
tert-butyl 3-[(S)-(4,4-difluorocyclohexyl)-hydroxymethyl]pyrrolidine-1-carboxylate (PubChem CID 66892200) has the molecular formula C16H27F2NO3
and a molecular weight of 319.39 g/mol. Its IUPAC name is tert-butyl 3-[(S)-(4,4-difluorocyclohexyl)-hydroxymethyl]pyrrolidine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 3-[(S)-(4,4-difluorocyclohexyl)-hydroxymethyl]pyrrolidine-1-carboxylate |
| PubChem CID | 66892200 |
| Molecular Formula | C16H27F2NO3 |
| Molecular Weight | 319.39 g/mol |
| Exact Mass | 319.20 |
| IUPAC Name | tert-butyl 3-[(S)-(4,4-difluorocyclohexyl)-hydroxymethyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC([C@@H](O)C2CCC(F)(F)CC2)C1 |
| InChI | InChI=1S/C16H27F2NO3/c1-15(2,3)22-14(21)19-9-6-12(10-19)13(20)11-4-7-16(17,18)8-5-11/h11-13,20H,4-10H2,1-3H3/t12?,13-/m0/s1 |
| InChIKey | NCBVZNPJECJQBS-ABLWVSNPSA-N |
| XLogP | 3.43 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.39 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze tert-butyl 3-[(S)-(4,4-difluorocyclohexyl)-hydroxymethyl]pyrrolidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 3-[(S)-(4,4-difluorocyclohexyl)-hydroxymethyl]pyrrolidine-1-carboxylate?
The IUPAC name of tert-butyl 3-[(S)-(4,4-difluorocyclohexyl)-hydroxymethyl]pyrrolidine-1-carboxylate (CID 66892200) is tert-butyl 3-[(S)-(4,4-difluorocyclohexyl)-hydroxymethyl]pyrrolidine-1-carboxylate.
What is the SMILES notation for tert-butyl 3-[(S)-(4,4-difluorocyclohexyl)-hydroxymethyl]pyrrolidine-1-carboxylate?
The canonical SMILES for tert-butyl 3-[(S)-(4,4-difluorocyclohexyl)-hydroxymethyl]pyrrolidine-1-carboxylate is CC(C)(C)OC(=O)N1CCC([C@@H](O)C2CCC(F)(F)CC2)C1.
What is the InChIKey of tert-butyl 3-[(S)-(4,4-difluorocyclohexyl)-hydroxymethyl]pyrrolidine-1-carboxylate?
The InChIKey is NCBVZNPJECJQBS-ABLWVSNPSA-N. The full InChI is InChI=1S/C16H27F2NO3/c1-15(2,3)22-14(21)19-9-6-12(10-19)13(20)11-4-7-16(17,18)8-5-11/h11-13,20H,4-10H2,1-3H3/t12?,13-/m0/s1.
What are the key properties of tert-butyl 3-[(S)-(4,4-difluorocyclohexyl)-hydroxymethyl]pyrrolidine-1-carboxylate?
tert-butyl 3-[(S)-(4,4-difluorocyclohexyl)-hydroxymethyl]pyrrolidine-1-carboxylate has a molecular weight of 319.39 g/mol, XLogP of 3.43, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 3-[(S)-(4,4-difluorocyclohexyl)-hydroxymethyl]pyrrolidine-1-carboxylate is sourced from PubChem (CID 66892200), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).