About azane;2-(2,2-dimethyl-1,3-dioxolan-4-yl)pyrazine
azane;2-(2,2-dimethyl-1,3-dioxolan-4-yl)pyrazine (PubChem CID 66892965) has the molecular formula C9H15N3O2
and a molecular weight of 197.24 g/mol. Its IUPAC name is azane;2-(2,2-dimethyl-1,3-dioxolan-4-yl)pyrazine.
Molecular Properties
| Compound Name | azane;2-(2,2-dimethyl-1,3-dioxolan-4-yl)pyrazine |
| PubChem CID | 66892965 |
| Molecular Formula | C9H15N3O2 |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | azane;2-(2,2-dimethyl-1,3-dioxolan-4-yl)pyrazine |
| SMILES | CC1(C)OCC(c2cnccn2)O1.N |
| InChI | InChI=1S/C9H12N2O2.H3N/c1-9(2)12-6-8(13-9)7-5-10-3-4-11-7;/h3-5,8H,6H2,1-2H3;1H3 |
| InChIKey | DBMFCXMOBPEXEB-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 79.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze azane;2-(2,2-dimethyl-1,3-dioxolan-4-yl)pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;2-(2,2-dimethyl-1,3-dioxolan-4-yl)pyrazine?
The IUPAC name of azane;2-(2,2-dimethyl-1,3-dioxolan-4-yl)pyrazine (CID 66892965) is azane;2-(2,2-dimethyl-1,3-dioxolan-4-yl)pyrazine.
What is the SMILES notation for azane;2-(2,2-dimethyl-1,3-dioxolan-4-yl)pyrazine?
The canonical SMILES for azane;2-(2,2-dimethyl-1,3-dioxolan-4-yl)pyrazine is CC1(C)OCC(c2cnccn2)O1.N.
What is the InChIKey of azane;2-(2,2-dimethyl-1,3-dioxolan-4-yl)pyrazine?
The InChIKey is DBMFCXMOBPEXEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O2.H3N/c1-9(2)12-6-8(13-9)7-5-10-3-4-11-7;/h3-5,8H,6H2,1-2H3;1H3.
What are the key properties of azane;2-(2,2-dimethyl-1,3-dioxolan-4-yl)pyrazine?
azane;2-(2,2-dimethyl-1,3-dioxolan-4-yl)pyrazine has a molecular weight of 197.24 g/mol, XLogP of 1.46, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for azane;2-(2,2-dimethyl-1,3-dioxolan-4-yl)pyrazine is sourced from PubChem (CID 66892965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).