C12H15F3N2O2S — CID 66893280
(R)-2-methyl-N-[[5-(2,2,2-trifluoroethoxy)-2-pyridinyl]methylidene]propane-2-sulfinamide (PubChem CID 66893280) has the molecular formula C12H15F3N2O2S and a molecular weight of 308.33 g/mol. Its IUPAC name is (R)-2-methyl-N-[[5-(2,2,2-trifluoroethoxy)-2-pyridinyl]methylidene]propane-2-sulfinamide.
| Compound Name | (R)-2-methyl-N-[[5-(2,2,2-trifluoroethoxy)-2-pyridinyl]methylidene]propane-2-sulfinamide |
|---|---|
| PubChem CID | 66893280 |
| Molecular Formula | C12H15F3N2O2S |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | (R)-2-methyl-N-[[5-(2,2,2-trifluoroethoxy)-2-pyridinyl]methylidene]propane-2-sulfinamide |
| SMILES | CC(C)(C)[S@@](=O)N=Cc1ccc(OCC(F)(F)F)cn1 |
| InChI | InChI=1S/C12H15F3N2O2S/c1-11(2,3)20(18)17-6-9-4-5-10(7-16-9)19-8-12(13,14)15/h4-7H,8H2,1-3H3/t20-/m1/s1 |
| InChIKey | VHPLBGLTPFEDGM-HXUWFJFHSA-N |
| XLogP | 2.90 |
| TPSA | 51.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|