About (R)-2-methyl-N-[[5-(2,2,2-trifluoroethoxy)-2-pyridinyl]methylidene]propane-2-sulfinamide
(R)-2-methyl-N-[[5-(2,2,2-trifluoroethoxy)-2-pyridinyl]methylidene]propane-2-sulfinamide (PubChem CID 66893280) has the molecular formula C12H15F3N2O2S
and a molecular weight of 308.33 g/mol. Its IUPAC name is (R)-2-methyl-N-[[5-(2,2,2-trifluoroethoxy)-2-pyridinyl]methylidene]propane-2-sulfinamide.
Molecular Properties
| Compound Name | (R)-2-methyl-N-[[5-(2,2,2-trifluoroethoxy)-2-pyridinyl]methylidene]propane-2-sulfinamide |
| PubChem CID | 66893280 |
| Molecular Formula | C12H15F3N2O2S |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | (R)-2-methyl-N-[[5-(2,2,2-trifluoroethoxy)-2-pyridinyl]methylidene]propane-2-sulfinamide |
| SMILES | CC(C)(C)[S@@](=O)N=Cc1ccc(OCC(F)(F)F)cn1 |
| InChI | InChI=1S/C12H15F3N2O2S/c1-11(2,3)20(18)17-6-9-4-5-10(7-16-9)19-8-12(13,14)15/h4-7H,8H2,1-3H3/t20-/m1/s1 |
| InChIKey | VHPLBGLTPFEDGM-HXUWFJFHSA-N |
| XLogP | 2.90 |
| TPSA | 51.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (R)-2-methyl-N-[[5-(2,2,2-trifluoroethoxy)-2-pyridinyl]methylidene]propane-2-sulfinamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (R)-2-methyl-N-[[5-(2,2,2-trifluoroethoxy)-2-pyridinyl]methylidene]propane-2-sulfinamide?
The IUPAC name of (R)-2-methyl-N-[[5-(2,2,2-trifluoroethoxy)-2-pyridinyl]methylidene]propane-2-sulfinamide (CID 66893280) is (R)-2-methyl-N-[[5-(2,2,2-trifluoroethoxy)-2-pyridinyl]methylidene]propane-2-sulfinamide.
What is the SMILES notation for (R)-2-methyl-N-[[5-(2,2,2-trifluoroethoxy)-2-pyridinyl]methylidene]propane-2-sulfinamide?
The canonical SMILES for (R)-2-methyl-N-[[5-(2,2,2-trifluoroethoxy)-2-pyridinyl]methylidene]propane-2-sulfinamide is CC(C)(C)[S@@](=O)N=Cc1ccc(OCC(F)(F)F)cn1.
What is the InChIKey of (R)-2-methyl-N-[[5-(2,2,2-trifluoroethoxy)-2-pyridinyl]methylidene]propane-2-sulfinamide?
The InChIKey is VHPLBGLTPFEDGM-HXUWFJFHSA-N. The full InChI is InChI=1S/C12H15F3N2O2S/c1-11(2,3)20(18)17-6-9-4-5-10(7-16-9)19-8-12(13,14)15/h4-7H,8H2,1-3H3/t20-/m1/s1.
What are the key properties of (R)-2-methyl-N-[[5-(2,2,2-trifluoroethoxy)-2-pyridinyl]methylidene]propane-2-sulfinamide?
(R)-2-methyl-N-[[5-(2,2,2-trifluoroethoxy)-2-pyridinyl]methylidene]propane-2-sulfinamide has a molecular weight of 308.33 g/mol, XLogP of 2.90, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (R)-2-methyl-N-[[5-(2,2,2-trifluoroethoxy)-2-pyridinyl]methylidene]propane-2-sulfinamide is sourced from PubChem (CID 66893280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).