C23H19N3 — CID 66893310
2-[2-(2,4,6-trimethylphenyl)ethynyl]benzo[f][1,7]naphthyridin-5-amine (PubChem CID 66893310) has the molecular formula C23H19N3 and a molecular weight of 337.43 g/mol. Its IUPAC name is 2-[2-(2,4,6-trimethylphenyl)ethynyl]benzo[f][1,7]naphthyridin-5-amine.
| Compound Name | 2-[2-(2,4,6-trimethylphenyl)ethynyl]benzo[f][1,7]naphthyridin-5-amine |
|---|---|
| PubChem CID | 66893310 |
| Molecular Formula | C23H19N3 |
| Molecular Weight | 337.43 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | 2-[2-(2,4,6-trimethylphenyl)ethynyl]benzo[f][1,7]naphthyridin-5-amine |
| SMILES | Cc1cc(C)c(C#Cc2cnc3c(N)nc4ccccc4c3c2)c(C)c1 |
| InChI | InChI=1S/C23H19N3/c1-14-10-15(2)18(16(3)11-14)9-8-17-12-20-19-6-4-5-7-21(19)26-23(24)22(20)25-13-17/h4-7,10-13H,1-3H3,(H2,24,26) |
| InChIKey | BBUINYBSWWCRRD-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.43 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|