About 3-undec-10-enoyl-3,4-dihydro-1H-pyridin-2-one
3-undec-10-enoyl-3,4-dihydro-1H-pyridin-2-one (PubChem CID 66893407) has the molecular formula C16H25NO2
and a molecular weight of 263.38 g/mol. Its IUPAC name is 3-undec-10-enoyl-3,4-dihydro-1H-pyridin-2-one.
Molecular Properties
| Compound Name | 3-undec-10-enoyl-3,4-dihydro-1H-pyridin-2-one |
| PubChem CID | 66893407 |
| Molecular Formula | C16H25NO2 |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.19 |
| IUPAC Name | 3-undec-10-enoyl-3,4-dihydro-1H-pyridin-2-one |
| SMILES | C=CCCCCCCCCC(=O)C1CC=CNC1=O |
| InChI | InChI=1S/C16H25NO2/c1-2-3-4-5-6-7-8-9-12-15(18)14-11-10-13-17-16(14)19/h2,10,13-14H,1,3-9,11-12H2,(H,17,19) |
| InChIKey | UCHMQZHWUCAZAP-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-undec-10-enoyl-3,4-dihydro-1H-pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-undec-10-enoyl-3,4-dihydro-1H-pyridin-2-one?
The IUPAC name of 3-undec-10-enoyl-3,4-dihydro-1H-pyridin-2-one (CID 66893407) is 3-undec-10-enoyl-3,4-dihydro-1H-pyridin-2-one.
What is the SMILES notation for 3-undec-10-enoyl-3,4-dihydro-1H-pyridin-2-one?
The canonical SMILES for 3-undec-10-enoyl-3,4-dihydro-1H-pyridin-2-one is C=CCCCCCCCCC(=O)C1CC=CNC1=O.
What is the InChIKey of 3-undec-10-enoyl-3,4-dihydro-1H-pyridin-2-one?
The InChIKey is UCHMQZHWUCAZAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25NO2/c1-2-3-4-5-6-7-8-9-12-15(18)14-11-10-13-17-16(14)19/h2,10,13-14H,1,3-9,11-12H2,(H,17,19).
What are the key properties of 3-undec-10-enoyl-3,4-dihydro-1H-pyridin-2-one?
3-undec-10-enoyl-3,4-dihydro-1H-pyridin-2-one has a molecular weight of 263.38 g/mol, XLogP of 3.51, 10 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-undec-10-enoyl-3,4-dihydro-1H-pyridin-2-one is sourced from PubChem (CID 66893407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).