About methyl (2S)-2-[[2-(2-chlorophenoxy)-4-oxo-4-propoxybut-2-enyl]amino]-4,4-difluoropentanoate
methyl (2S)-2-[[2-(2-chlorophenoxy)-4-oxo-4-propoxybut-2-enyl]amino]-4,4-difluoropentanoate (PubChem CID 66893519) has the molecular formula C19H24ClF2NO5
and a molecular weight of 419.85 g/mol. Its IUPAC name is methyl (2S)-2-[[2-(2-chlorophenoxy)-4-oxo-4-propoxybut-2-enyl]amino]-4,4-difluoropentanoate.
Molecular Properties
| Compound Name | methyl (2S)-2-[[2-(2-chlorophenoxy)-4-oxo-4-propoxybut-2-enyl]amino]-4,4-difluoropentanoate |
| PubChem CID | 66893519 |
| Molecular Formula | C19H24ClF2NO5 |
| Molecular Weight | 419.85 g/mol |
| Exact Mass | 419.13 |
| IUPAC Name | methyl (2S)-2-[[2-(2-chlorophenoxy)-4-oxo-4-propoxybut-2-enyl]amino]-4,4-difluoropentanoate |
| SMILES | CCCOC(=O)C=C(CN[C@@H](CC(C)(F)F)C(=O)OC)Oc1ccccc1Cl |
| InChI | InChI=1S/C19H24ClF2NO5/c1-4-9-27-17(24)10-13(28-16-8-6-5-7-14(16)20)12-23-15(18(25)26-3)11-19(2,21)22/h5-8,10,15,23H,4,9,11-12H2,1-3H3/t15-/m0/s1 |
| InChIKey | DISHJAPEPDTWOQ-HNNXBMFYSA-N |
| XLogP | 3.73 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 419.85 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl (2S)-2-[[2-(2-chlorophenoxy)-4-oxo-4-propoxybut-2-enyl]amino]-4,4-difluoropentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2S)-2-[[2-(2-chlorophenoxy)-4-oxo-4-propoxybut-2-enyl]amino]-4,4-difluoropentanoate?
The IUPAC name of methyl (2S)-2-[[2-(2-chlorophenoxy)-4-oxo-4-propoxybut-2-enyl]amino]-4,4-difluoropentanoate (CID 66893519) is methyl (2S)-2-[[2-(2-chlorophenoxy)-4-oxo-4-propoxybut-2-enyl]amino]-4,4-difluoropentanoate.
What is the SMILES notation for methyl (2S)-2-[[2-(2-chlorophenoxy)-4-oxo-4-propoxybut-2-enyl]amino]-4,4-difluoropentanoate?
The canonical SMILES for methyl (2S)-2-[[2-(2-chlorophenoxy)-4-oxo-4-propoxybut-2-enyl]amino]-4,4-difluoropentanoate is CCCOC(=O)C=C(CN[C@@H](CC(C)(F)F)C(=O)OC)Oc1ccccc1Cl.
What is the InChIKey of methyl (2S)-2-[[2-(2-chlorophenoxy)-4-oxo-4-propoxybut-2-enyl]amino]-4,4-difluoropentanoate?
The InChIKey is DISHJAPEPDTWOQ-HNNXBMFYSA-N. The full InChI is InChI=1S/C19H24ClF2NO5/c1-4-9-27-17(24)10-13(28-16-8-6-5-7-14(16)20)12-23-15(18(25)26-3)11-19(2,21)22/h5-8,10,15,23H,4,9,11-12H2,1-3H3/t15-/m0/s1.
What are the key properties of methyl (2S)-2-[[2-(2-chlorophenoxy)-4-oxo-4-propoxybut-2-enyl]amino]-4,4-difluoropentanoate?
methyl (2S)-2-[[2-(2-chlorophenoxy)-4-oxo-4-propoxybut-2-enyl]amino]-4,4-difluoropentanoate has a molecular weight of 419.85 g/mol, XLogP of 3.73, 11 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2S)-2-[[2-(2-chlorophenoxy)-4-oxo-4-propoxybut-2-enyl]amino]-4,4-difluoropentanoate is sourced from PubChem (CID 66893519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).