C18H30FNO4 — CID 66893587
1-fluorobutyl 2,2-dimethyl-4-(2-prop-2-enoxypent-4-enyl)-1,3-oxazolidine-3-carboxylate (PubChem CID 66893587) has the molecular formula C18H30FNO4 and a molecular weight of 343.44 g/mol. Its IUPAC name is 1-fluorobutyl 2,2-dimethyl-4-(2-prop-2-enoxypent-4-enyl)-1,3-oxazolidine-3-carboxylate.
| Compound Name | 1-fluorobutyl 2,2-dimethyl-4-(2-prop-2-enoxypent-4-enyl)-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 66893587 |
| Molecular Formula | C18H30FNO4 |
| Molecular Weight | 343.44 g/mol |
| Exact Mass | 343.22 |
| IUPAC Name | 1-fluorobutyl 2,2-dimethyl-4-(2-prop-2-enoxypent-4-enyl)-1,3-oxazolidine-3-carboxylate |
| SMILES | C=CCOC(CC=C)CC1COC(C)(C)N1C(=O)OC(F)CCC |
| InChI | InChI=1S/C18H30FNO4/c1-6-9-15(22-11-8-3)12-14-13-23-18(4,5)20(14)17(21)24-16(19)10-7-2/h6,8,14-16H,1,3,7,9-13H2,2,4-5H3 |
| InChIKey | ZRWRVWQJYOTJJY-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.44 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|