4-[1-(2,4-dioxo-1H-quinazolin-3-yl)ethyl]benzoic acid

C17H14N2O4 — CID 66893674

IUPAC4-[1-(2,4-dioxo-1H-quinazolin-3-yl)ethyl]benzoic acid
SMILESCC(c1ccc(C(=O)O)cc1)n1c(=O)[nH]c2ccccc2c1=O
InChIInChI=1S/C17H14N2O4/c1-10(11-6-8-12(9-7-11)16(21)22)19-15(20)13-4-2-3-5-14(13)18-17(19)23/h2-10H,1H3,(H,18,23)(H,21,22)
InChIKeyJZXHYQWXTIFIOL-UHFFFAOYSA-N
MW310.31 g/mol
LogP2.00
Rot. Bonds3

About 4-[1-(2,4-dioxo-1H-quinazolin-3-yl)ethyl]benzoic acid

4-[1-(2,4-dioxo-1H-quinazolin-3-yl)ethyl]benzoic acid (PubChem CID 66893674) has the molecular formula C17H14N2O4 and a molecular weight of 310.31 g/mol. Its IUPAC name is 4-[1-(2,4-dioxo-1H-quinazolin-3-yl)ethyl]benzoic acid.

Molecular Properties

Compound Name4-[1-(2,4-dioxo-1H-quinazolin-3-yl)ethyl]benzoic acid
PubChem CID66893674
Molecular FormulaC17H14N2O4
Molecular Weight310.31 g/mol
Exact Mass310.10
IUPAC Name4-[1-(2,4-dioxo-1H-quinazolin-3-yl)ethyl]benzoic acid
SMILESCC(c1ccc(C(=O)O)cc1)n1c(=O)[nH]c2ccccc2c1=O
InChIInChI=1S/C17H14N2O4/c1-10(11-6-8-12(9-7-11)16(21)22)19-15(20)13-4-2-3-5-14(13)18-17(19)23/h2-10H,1H3,(H,18,23)(H,21,22)
InChIKeyJZXHYQWXTIFIOL-UHFFFAOYSA-N
XLogP2.00
TPSA92.16 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500310.31
LogP ≤ 52.00
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 4-[1-(2,4-dioxo-1H-quinazolin-3-yl)ethyl]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[1-(2,4-dioxo-1H-quinazolin-3-yl)ethyl]benzoic acid?
The IUPAC name of 4-[1-(2,4-dioxo-1H-quinazolin-3-yl)ethyl]benzoic acid (CID 66893674) is 4-[1-(2,4-dioxo-1H-quinazolin-3-yl)ethyl]benzoic acid.
What is the SMILES notation for 4-[1-(2,4-dioxo-1H-quinazolin-3-yl)ethyl]benzoic acid?
The canonical SMILES for 4-[1-(2,4-dioxo-1H-quinazolin-3-yl)ethyl]benzoic acid is CC(c1ccc(C(=O)O)cc1)n1c(=O)[nH]c2ccccc2c1=O.
What is the InChIKey of 4-[1-(2,4-dioxo-1H-quinazolin-3-yl)ethyl]benzoic acid?
The InChIKey is JZXHYQWXTIFIOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14N2O4/c1-10(11-6-8-12(9-7-11)16(21)22)19-15(20)13-4-2-3-5-14(13)18-17(19)23/h2-10H,1H3,(H,18,23)(H,21,22).
What are the key properties of 4-[1-(2,4-dioxo-1H-quinazolin-3-yl)ethyl]benzoic acid?
4-[1-(2,4-dioxo-1H-quinazolin-3-yl)ethyl]benzoic acid has a molecular weight of 310.31 g/mol, XLogP of 2.00, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1-(2,4-dioxo-1H-quinazolin-3-yl)ethyl]benzoic acid is sourced from PubChem (CID 66893674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).