C7H10N4O2 — CID 66893932
(5S)-5-[(3-aminopyrazol-1-yl)methyl]-1,3-oxazolidin-2-one (PubChem CID 66893932) has the molecular formula C7H10N4O2 and a molecular weight of 182.18 g/mol. Its IUPAC name is (5S)-5-[(3-aminopyrazol-1-yl)methyl]-1,3-oxazolidin-2-one.
| Compound Name | (5S)-5-[(3-aminopyrazol-1-yl)methyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 66893932 |
| Molecular Formula | C7H10N4O2 |
| Molecular Weight | 182.18 g/mol |
| Exact Mass | 182.08 |
| IUPAC Name | (5S)-5-[(3-aminopyrazol-1-yl)methyl]-1,3-oxazolidin-2-one |
| SMILES | Nc1ccn(C[C@@H]2CNC(=O)O2)n1 |
| InChI | InChI=1S/C7H10N4O2/c8-6-1-2-11(10-6)4-5-3-9-7(12)13-5/h1-2,5H,3-4H2,(H2,8,10)(H,9,12)/t5-/m0/s1 |
| InChIKey | UMYZMBMNMGVIEP-YFKPBYRVSA-N |
| XLogP | -0.43 |
| TPSA | 82.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.18 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |