C44H44N4 — CID 66894192
2,3,5,7,8,10,12,13-octakis(prop-2-enyl)porphyrin (PubChem CID 66894192) has the molecular formula C44H44N4 and a molecular weight of 628.86 g/mol. Its IUPAC name is 2,3,5,7,8,10,12,13-octakis(prop-2-enyl)porphyrin.
| Compound Name | 2,3,5,7,8,10,12,13-octakis(prop-2-enyl)porphyrin |
|---|---|
| PubChem CID | 66894192 |
| Molecular Formula | C44H44N4 |
| Molecular Weight | 628.86 g/mol |
| Exact Mass | 628.36 |
| IUPAC Name | 2,3,5,7,8,10,12,13-octakis(prop-2-enyl)porphyrin |
| SMILES | C=CCC1=C(CC=C)/C2=C/C3=N/C(=C\C4=N/C(=C(/CC=C)C5=N/C(=C(/CC=C)C1=N2)C(CC=C)=C5CC=C)C(CC=C)=C4CC=C)C=C3 |
| InChI | InChI=1S/C44H44N4/c1-9-17-31-33(19-11-3)41-37(23-15-7)43-35(21-13-5)36(22-14-6)44(48-43)38(24-16-8)42-34(20-12-4)32(18-10-2)40(47-42)28-30-26-25-29(45-30)27-39(31)46-41/h9-16,25-28H,1-8,17-24H2/b29-27-,30-28-,39-27-,40-28-,41-37-,42-38-,43-37-,44-38- |
| InChIKey | UYNVDDIAVSBDDZ-LFVZFSQMSA-N |
| XLogP | 11.15 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.86 |
| LogP ≤ 5 | 11.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|