C14H18N4O2S — CID 66894398
2-[(1S,3R)-3-(1,2,4-triazol-4-yl)cyclohexyl]benzenesulfonamide (PubChem CID 66894398) has the molecular formula C14H18N4O2S and a molecular weight of 306.39 g/mol. Its IUPAC name is 2-[(1S,3R)-3-(1,2,4-triazol-4-yl)cyclohexyl]benzenesulfonamide.
| Compound Name | 2-[(1S,3R)-3-(1,2,4-triazol-4-yl)cyclohexyl]benzenesulfonamide |
|---|---|
| PubChem CID | 66894398 |
| Molecular Formula | C14H18N4O2S |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 2-[(1S,3R)-3-(1,2,4-triazol-4-yl)cyclohexyl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccccc1[C@H]1CCC[C@@H](n2cnnc2)C1 |
| InChI | InChI=1S/C14H18N4O2S/c15-21(19,20)14-7-2-1-6-13(14)11-4-3-5-12(8-11)18-9-16-17-10-18/h1-2,6-7,9-12H,3-5,8H2,(H2,15,19,20)/t11-,12+/m0/s1 |
| InChIKey | SKVJDDDKXBWHGZ-NWDGAFQWSA-N |
| XLogP | 1.82 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |