About CID 66894575
CID 66894575 (PubChem CID 66894575) has the molecular formula C16H22NOSSi
and a molecular weight of 304.51 g/mol.
Molecular Properties
| Compound Name | CID 66894575 |
| PubChem CID | 66894575 |
| Molecular Formula | C16H22NOSSi |
| Molecular Weight | 304.51 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | — |
| SMILES | C[Si](C)c1c(-c2cccs2)ccc(OC(C)(C)C)c1N |
| InChI | InChI=1S/C16H22NOSSi/c1-16(2,3)18-12-9-8-11(13-7-6-10-19-13)15(14(12)17)20(4)5/h6-10H,17H2,1-5H3 |
| InChIKey | LBTKEBITHHFORV-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.51 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 66894575 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 66894575?
The IUPAC name of CID 66894575 (CID 66894575) is not available.
What is the SMILES notation for CID 66894575?
The canonical SMILES for CID 66894575 is C[Si](C)c1c(-c2cccs2)ccc(OC(C)(C)C)c1N.
What is the InChIKey of CID 66894575?
The InChIKey is LBTKEBITHHFORV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22NOSSi/c1-16(2,3)18-12-9-8-11(13-7-6-10-19-13)15(14(12)17)20(4)5/h6-10H,17H2,1-5H3.
What are the key properties of CID 66894575?
CID 66894575 has a molecular weight of 304.51 g/mol, XLogP of 4.14, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 66894575 is sourced from PubChem (CID 66894575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).