C25H60O5Si5 — CID 66894597
2,4,6,8,10-penta(butan-2-yl)-2,4,6,8,10-pentamethyl-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecane (PubChem CID 66894597) has the molecular formula C25H60O5Si5 and a molecular weight of 581.18 g/mol. Its IUPAC name is 2,4,6,8,10-penta(butan-2-yl)-2,4,6,8,10-pentamethyl-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecane.
| Compound Name | 2,4,6,8,10-penta(butan-2-yl)-2,4,6,8,10-pentamethyl-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecane |
|---|---|
| PubChem CID | 66894597 |
| Molecular Formula | C25H60O5Si5 |
| Molecular Weight | 581.18 g/mol |
| Exact Mass | 580.33 |
| IUPAC Name | 2,4,6,8,10-penta(butan-2-yl)-2,4,6,8,10-pentamethyl-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecane |
| SMILES | CCC(C)[Si]1(C)O[Si](C)(C(C)CC)O[Si](C)(C(C)CC)O[Si](C)(C(C)CC)O[Si](C)(C(C)CC)O1 |
| InChI | InChI=1S/C25H60O5Si5/c1-16-21(6)31(11)26-32(12,22(7)17-2)28-34(14,24(9)19-4)30-35(15,25(10)20-5)29-33(13,27-31)23(8)18-3/h21-25H,16-20H2,1-15H3 |
| InChIKey | YFHHUYVJXMNMGT-UHFFFAOYSA-N |
| XLogP | 9.44 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.18 |
| LogP ≤ 5 | 9.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|