C25H60O5Si5 — CID 66894599
2,4,6,8,10-pentaethyl-2,4,6,8,10-penta(propan-2-yl)-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecane (PubChem CID 66894599) has the molecular formula C25H60O5Si5 and a molecular weight of 581.18 g/mol. Its IUPAC name is 2,4,6,8,10-pentaethyl-2,4,6,8,10-penta(propan-2-yl)-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecane.
| Compound Name | 2,4,6,8,10-pentaethyl-2,4,6,8,10-penta(propan-2-yl)-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecane |
|---|---|
| PubChem CID | 66894599 |
| Molecular Formula | C25H60O5Si5 |
| Molecular Weight | 581.18 g/mol |
| Exact Mass | 580.33 |
| IUPAC Name | 2,4,6,8,10-pentaethyl-2,4,6,8,10-penta(propan-2-yl)-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecane |
| SMILES | CC[Si]1(C(C)C)O[Si](CC)(C(C)C)O[Si](CC)(C(C)C)O[Si](CC)(C(C)C)O[Si](CC)(C(C)C)O1 |
| InChI | InChI=1S/C25H60O5Si5/c1-16-31(21(6)7)26-32(17-2,22(8)9)28-34(19-4,24(12)13)30-35(20-5,25(14)15)29-33(18-3,27-31)23(10)11/h21-25H,16-20H2,1-15H3 |
| InChIKey | CZUCHHRAHJBRMQ-UHFFFAOYSA-N |
| XLogP | 9.44 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.18 |
| LogP ≤ 5 | 9.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|