About 1,3-benzoxazol-4-ol;ethyl acetate
1,3-benzoxazol-4-ol;ethyl acetate (PubChem CID 66895346) has the molecular formula C11H13NO4
and a molecular weight of 223.23 g/mol. Its IUPAC name is 1,3-benzoxazol-4-ol;ethyl acetate.
Molecular Properties
| Compound Name | 1,3-benzoxazol-4-ol;ethyl acetate |
| PubChem CID | 66895346 |
| Molecular Formula | C11H13NO4 |
| Molecular Weight | 223.23 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | 1,3-benzoxazol-4-ol;ethyl acetate |
| SMILES | CCOC(C)=O.Oc1cccc2ocnc12 |
| InChI | InChI=1S/C7H5NO2.C4H8O2/c9-5-2-1-3-6-7(5)8-4-10-6;1-3-6-4(2)5/h1-4,9H;3H2,1-2H3 |
| InChIKey | MNDVSEPBHWPIEI-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 72.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.23 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1,3-benzoxazol-4-ol;ethyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-benzoxazol-4-ol;ethyl acetate?
The IUPAC name of 1,3-benzoxazol-4-ol;ethyl acetate (CID 66895346) is 1,3-benzoxazol-4-ol;ethyl acetate.
What is the SMILES notation for 1,3-benzoxazol-4-ol;ethyl acetate?
The canonical SMILES for 1,3-benzoxazol-4-ol;ethyl acetate is CCOC(C)=O.Oc1cccc2ocnc12.
What is the InChIKey of 1,3-benzoxazol-4-ol;ethyl acetate?
The InChIKey is MNDVSEPBHWPIEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5NO2.C4H8O2/c9-5-2-1-3-6-7(5)8-4-10-6;1-3-6-4(2)5/h1-4,9H;3H2,1-2H3.
What are the key properties of 1,3-benzoxazol-4-ol;ethyl acetate?
1,3-benzoxazol-4-ol;ethyl acetate has a molecular weight of 223.23 g/mol, XLogP of 2.10, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-benzoxazol-4-ol;ethyl acetate is sourced from PubChem (CID 66895346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).