C11H14O2 — CID 66895402
3a,4,5,6,7,9b-hexahydrobenzo[e][1,3]benzodioxole (PubChem CID 66895402) has the molecular formula C11H14O2 and a molecular weight of 178.23 g/mol. Its IUPAC name is 3a,4,5,6,7,9b-hexahydrobenzo[e][1,3]benzodioxole.
| Compound Name | 3a,4,5,6,7,9b-hexahydrobenzo[e][1,3]benzodioxole |
|---|---|
| PubChem CID | 66895402 |
| Molecular Formula | C11H14O2 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | 3a,4,5,6,7,9b-hexahydrobenzo[e][1,3]benzodioxole |
| SMILES | C1=CC2=C(CC1)CCC1OCOC21 |
| InChI | InChI=1S/C11H14O2/c1-2-4-9-8(3-1)5-6-10-11(9)13-7-12-10/h2,4,10-11H,1,3,5-7H2 |
| InChIKey | NWYDCEXTDGXGAU-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |