C23H26F3N5O3S — CID 66895635
2-ethyl-N-[(1S,3R)-3-(1,2,4-triazol-4-yl)cyclohexyl]-4-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]benzenesulfonamide (PubChem CID 66895635) has the molecular formula C23H26F3N5O3S and a molecular weight of 509.55 g/mol. Its IUPAC name is 2-ethyl-N-[(1S,3R)-3-(1,2,4-triazol-4-yl)cyclohexyl]-4-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]benzenesulfonamide.
| Compound Name | 2-ethyl-N-[(1S,3R)-3-(1,2,4-triazol-4-yl)cyclohexyl]-4-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]benzenesulfonamide |
|---|---|
| PubChem CID | 66895635 |
| Molecular Formula | C23H26F3N5O3S |
| Molecular Weight | 509.55 g/mol |
| Exact Mass | 509.17 |
| IUPAC Name | 2-ethyl-N-[(1S,3R)-3-(1,2,4-triazol-4-yl)cyclohexyl]-4-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]benzenesulfonamide |
| SMILES | CCc1cc(-c2ccc(OCC(F)(F)F)nc2)ccc1S(=O)(=O)N[C@H]1CCC[C@@H](n2cnnc2)C1 |
| InChI | InChI=1S/C23H26F3N5O3S/c1-2-16-10-17(18-7-9-22(27-12-18)34-13-23(24,25)26)6-8-21(16)35(32,33)30-19-4-3-5-20(11-19)31-14-28-29-15-31/h6-10,12,14-15,19-20,30H,2-5,11,13H2,1H3/t19-,20+/m0/s1 |
| InChIKey | YSBKFTIQZVGGBQ-VQTJNVASSA-N |
| XLogP | 4.31 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.55 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |