About methyl (2S,4R)-4-(3-ethenylquinolin-2-yl)oxypyrrolidine-2-carboxylate;hydrochloride
methyl (2S,4R)-4-(3-ethenylquinolin-2-yl)oxypyrrolidine-2-carboxylate;hydrochloride (PubChem CID 66895730) has the molecular formula C17H19ClN2O3
and a molecular weight of 334.80 g/mol. Its IUPAC name is methyl (2S,4R)-4-(3-ethenylquinolin-2-yl)oxypyrrolidine-2-carboxylate;hydrochloride.
Molecular Properties
| Compound Name | methyl (2S,4R)-4-(3-ethenylquinolin-2-yl)oxypyrrolidine-2-carboxylate;hydrochloride |
| PubChem CID | 66895730 |
| Molecular Formula | C17H19ClN2O3 |
| Molecular Weight | 334.80 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | methyl (2S,4R)-4-(3-ethenylquinolin-2-yl)oxypyrrolidine-2-carboxylate;hydrochloride |
| SMILES | C=Cc1cc2ccccc2nc1O[C@H]1CN[C@H](C(=O)OC)C1.Cl |
| InChI | InChI=1S/C17H18N2O3.ClH/c1-3-11-8-12-6-4-5-7-14(12)19-16(11)22-13-9-15(18-10-13)17(20)21-2;/h3-8,13,15,18H,1,9-10H2,2H3;1H/t13-,15+;/m1./s1 |
| InChIKey | IZSBSAKSCVXZGH-PBCQUBLHSA-N |
| XLogP | 2.58 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.80 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl (2S,4R)-4-(3-ethenylquinolin-2-yl)oxypyrrolidine-2-carboxylate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2S,4R)-4-(3-ethenylquinolin-2-yl)oxypyrrolidine-2-carboxylate;hydrochloride?
The IUPAC name of methyl (2S,4R)-4-(3-ethenylquinolin-2-yl)oxypyrrolidine-2-carboxylate;hydrochloride (CID 66895730) is methyl (2S,4R)-4-(3-ethenylquinolin-2-yl)oxypyrrolidine-2-carboxylate;hydrochloride.
What is the SMILES notation for methyl (2S,4R)-4-(3-ethenylquinolin-2-yl)oxypyrrolidine-2-carboxylate;hydrochloride?
The canonical SMILES for methyl (2S,4R)-4-(3-ethenylquinolin-2-yl)oxypyrrolidine-2-carboxylate;hydrochloride is C=Cc1cc2ccccc2nc1O[C@H]1CN[C@H](C(=O)OC)C1.Cl.
What is the InChIKey of methyl (2S,4R)-4-(3-ethenylquinolin-2-yl)oxypyrrolidine-2-carboxylate;hydrochloride?
The InChIKey is IZSBSAKSCVXZGH-PBCQUBLHSA-N. The full InChI is InChI=1S/C17H18N2O3.ClH/c1-3-11-8-12-6-4-5-7-14(12)19-16(11)22-13-9-15(18-10-13)17(20)21-2;/h3-8,13,15,18H,1,9-10H2,2H3;1H/t13-,15+;/m1./s1.
What are the key properties of methyl (2S,4R)-4-(3-ethenylquinolin-2-yl)oxypyrrolidine-2-carboxylate;hydrochloride?
methyl (2S,4R)-4-(3-ethenylquinolin-2-yl)oxypyrrolidine-2-carboxylate;hydrochloride has a molecular weight of 334.80 g/mol, XLogP of 2.58, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2S,4R)-4-(3-ethenylquinolin-2-yl)oxypyrrolidine-2-carboxylate;hydrochloride is sourced from PubChem (CID 66895730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).