About CID 66895763
CID 66895763 (PubChem CID 66895763) has the molecular formula C12H21BN
and a molecular weight of 190.12 g/mol.
Molecular Properties
| Compound Name | CID 66895763 |
| PubChem CID | 66895763 |
| Molecular Formula | C12H21BN |
| Molecular Weight | 190.12 g/mol |
| Exact Mass | 190.18 |
| IUPAC Name | — |
| SMILES | CC(C)C1=N[B]C(C(C)C)=C1C(C)C |
| InChI | InChI=1S/C12H21BN/c1-7(2)10-11(8(3)4)13-14-12(10)9(5)6/h7-9H,1-6H3 |
| InChIKey | BCIZXNQRCTWHMM-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.12 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 66895763 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 66895763?
The IUPAC name of CID 66895763 (CID 66895763) is not available.
What is the SMILES notation for CID 66895763?
The canonical SMILES for CID 66895763 is CC(C)C1=N[B]C(C(C)C)=C1C(C)C.
What is the InChIKey of CID 66895763?
The InChIKey is BCIZXNQRCTWHMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21BN/c1-7(2)10-11(8(3)4)13-14-12(10)9(5)6/h7-9H,1-6H3.
What are the key properties of CID 66895763?
CID 66895763 has a molecular weight of 190.12 g/mol, XLogP of 3.28, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 66895763 is sourced from PubChem (CID 66895763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).